Benzyltriethylammonium hydroxide

{{Chembox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| ImageFile = Benzyltriethylammonium hydroxide.svg

| ImageSize =

| ImageAlt =

| ImageFile1 =

| ImageSize1 =

| ImageAlt1 =

| IUPACName = N-Benzyl-N,N-diethylethanaminium hydroxide

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 1836-42-6

| UNII_Ref =

| UNII =

| SMILES = CC[N+](CC)(CC)Cc1ccccc1.[OH-]

| PubChem = 74601

| ChemSpiderID_Ref =

| ChemSpiderID = 67178

| InChI = 1S/C13H22N.H2O/c1-4-14(5-2,6-3)12-13-10-8-7-9-11-13;/h7-11H,4-6,12H2,1-3H3;1H2/q+1;/p-1

| InChIKey = FKPSBYZGRQJIMO-UHFFFAOYSA-M

| StdInChI_Ref =

| StdInChI =

| StdInChIKey_Ref =

| StdInChIKey =

}}

| Section2 = {{Chembox Properties

| C=13 | H=23 | N=1 | O=1

}}

}}

Benzyltriethylammonium hydroxide is a quaternary ammonium salt that functions as an organic base.

Uses

Together with benzyltrimethylammonium hydroxide, salts of benzyltriethylammonium are common phase-transfer catalysts.{{cite book | doi = 10.1002/14356007.a19_293| chapter = Phase-Transfer Catalysis| title = Ullmann's Encyclopedia of Industrial Chemistry| year = 2000| last1 = Halpern| first1 = Marc| isbn = 3527306730}}

References