Bepridil

{{Short description|Calcium channel blocker medication}}

{{Drugbox

| verifiedrevid = 459957378

| IUPAC_name = N-benzyl-N-(3-isobutoxy-2-pyrrolidin-1-yl-propyl)aniline

| image = Bepridil.svg

| tradename = Vascor

| Drugs.com = {{drugs.com|monograph|nifedipine}}

| MedlinePlus = a699051

| pregnancy_US = C

| pregnancy_category =

| legal_status =

| routes_of_administration = Oral

| bioavailability = Well absorbed

| protein_bound = 99%

| metabolism = Hepatic, CYP3A4-mediated

| elimination_half-life = 42 hours

| excretion = Renal

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 64706-54-3

| ATC_prefix = C08

| ATC_suffix = EA02

| PubChem = 2351

| IUPHAR_ligand = 2337

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB01244

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 2261

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 755BO701MA

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 3061

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 1008

| KEGG = D07520

| C=24 | H=34

| N=2 | O=1

| smiles = O(CC(C)C)CC(N1CCCC1)CN(c2ccccc2)Cc3ccccc3

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C24H34N2O/c1-21(2)19-27-20-24(25-15-9-10-16-25)18-26(23-13-7-4-8-14-23)17-22-11-5-3-6-12-22/h3-8,11-14,21,24H,9-10,15-20H2,1-2H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = UIEATEWHFDRYRU-UHFFFAOYSA-N

}}

Bepridil (trade name Vascor) is an diamine calcium channel blocker once used to treat angina pectoris. It is no longer sold in the United States.

It is nonselective.{{cite journal | vauthors = Bezprozvanny I, Tsien RW | title = Voltage-dependent blockade of diverse types of voltage-gated Ca2+ channels expressed in Xenopus oocytes by the Ca2+ channel antagonist mibefradil (Ro 40-5967) | journal = Molecular Pharmacology | volume = 48 | issue = 3 | pages = 540–549 | date = September 1995 | doi = 10.1016/S0026-895X(25)10504-X | pmid = 7565636 | url = http://molpharm.aspetjournals.org/cgi/pmidlookup?view=long&pmid=7565636 }}

It has been discussed as a possible option in the treatment of atrial fibrillation.{{cite journal | vauthors = Imai S, Saito F, Takase H, Enomoto M, Aoyama H, Yamaji S, Yokoyama K, Yagi H, Kushiro T, Hirayama A | display-authors = 6 | title = Use of bepridil in combination with Ic antiarrhythmic agent in converting persistent atrial fibrillation to sinus rhythm | journal = Circulation Journal | volume = 72 | issue = 5 | pages = 709–715 | date = May 2008 | pmid = 18441448 | doi = 10.1253/circj.72.709 | doi-access = free }}

It has been implicated in causing ventricular arrhythmia (torsades de pointes).