Beraprost

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 447623508

| IUPAC_name = 4-{(1R,2R,3aS,8bS)-2-Hydroxy-1-[(1E,3S)-3-hydroxy-4-methyl-1-octen-6-yn-1-yl]-2,3,3a,8b-tetrahydro-1H-benzo[b]cyclopenta[d]furan-5-yl}butanoic acid

| image = Beraprost.svg

| width = 300

| tradename = Dorner

| Drugs.com = {{drugs.com|international|beraprost}}

| pregnancy_category =

| legal_status =

| routes_of_administration = Oral

| bioavailability = 50–70%

| metabolism = Unknown

| elimination_half-life = 35–40 minutes

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 88430-50-6

| CAS_supplemental = {{CAS|88475-69-8}}

| ATC_prefix = B01

| ATC_suffix = AC19

| ChEBI = 135633

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1207745

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 5293169

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C24H30O5/c1-3-4-7-15(2)19(25)13-12-17-20(26)14-21-23(17)18-10-5-8-16(24(18)29-21)9-6-11-22(27)28/h5,8,10,12-13,15,17,19-21,23,25-26H,6-7,9,11,14H2,1-2H3,(H,27,28)/b13-12+/t15?,17-,19+,20+,21-,23-/m0/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = CTPOHARTNNSRSR-APJZLKAGSA-N

| PubChem = 6917951

| IUPHAR_ligand = 1967

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 35E3NJJ4O6

| C=24 | H=30 | O=5

| smiles = CC#CCC(C)[C@@H](/C=C/[C@H]1[C@@H](C[C@H]2[C@@H]1C3=CC=CC(=C3O2)CCCC(=O)O)O)O

}}

Beraprost is a pharmaceutical drug used in several Asian countries, including Japan and South Korea, as a vasodilator and antiplatelet agent.{{Cite web | url = https://www.drugs.com/international/beraprost.html | title = Beraprost | publisher = drugs.com}} It is classified as a prostacyclin analog.{{cite journal | vauthors = Melian EB, Goa KL | title = Beraprost: a review of its pharmacology and therapeutic efficacy in the treatment of peripheral arterial disease and pulmonary arterial hypertension | journal = Drugs | volume = 62 | issue = 1 | pages = 107–33 | date = 2002 | pmid = 11790158 | doi = 10.2165/00003495-200262010-00005 }}

It has been studied for the treatment of pulmonary hypertension and for use in avoiding reperfusion injury.