Berotralstat

{{Short description|Medication}}

{{Use American English|date=July 2021}}

{{Use dmy dates|date=August 2021}}

{{Infobox drug

| drug_name =

| INN =

| image = Berotralstat Structure.svg

| width =

| alt =

| caption =

| pronounce =

| tradename = Orladeyo

| Drugs.com =

| MedlinePlus =

| licence_CA =

| licence_EU = yes

| DailyMedID = Berotralstat

| licence_US =

| pregnancy_AU =

| pregnancy_AU_comment =

| pregnancy_category=

| routes_of_administration = By mouth

| class = Plasma kallikrein inhibitor

| ATCvet =

| ATC_prefix = B06

| ATC_suffix = AC06

| ATC_supplemental =

| legal_AU =

| legal_AU_comment =

| legal_BR =

| legal_BR_comment =

| legal_CA = Rx-only

| legal_CA_comment = {{cite web | title=Summary Basis of Decision - Orladeyo | website=Health Canada | date=23 October 2014 | url=https://hpr-rps.hres.ca/reg-content/summary-basis-decision-detailTwo.php?linkID=SBD00610&lang=en | access-date=28 November 2022}}[https://pdf.hres.ca/dpd_pm/00066149.PDF Product monograph] hres.ca

| legal_DE =

| legal_DE_comment =

| legal_NZ =

| legal_NZ_comment =

| legal_UK =

| legal_UK_comment =

| legal_US = Rx-only

| legal_US_comment = {{cite web | title=Orladeyo- berotralstat hydrochloride capsule | website=DailyMed | url=https://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?setid=3527ece1-e7e0-40b1-b0c5-6baeb0deabeb | access-date=25 December 2020}}{{cite web | title=Drug Trials Snapshot: Orladeyo | website=U.S. Food and Drug Administration | date=3 December 2020 | url=https://www.fda.gov/drugs/drug-approvals-and-databases/drug-trials-snapshot-orladeyo | archive-url=https://web.archive.org/web/20201218144319/https://www.fda.gov/drugs/drug-approvals-and-databases/drug-trials-snapshot-orladeyo | url-status=dead | archive-date=18 December 2020 | access-date=25 December 2020}} {{PD-notice}}

| legal_EU = Rx-only

| legal_EU_comment = {{cite web | title=Orladeyo EPAR | website=European Medicines Agency (EMA) | date=24 February 2021 | url=https://www.ema.europa.eu/en/medicines/human/EPAR/orladeyo | access-date=12 July 2021}}{{cite web | title=Orladeyo Product information | website=Union Register of medicinal products | url=https://ec.europa.eu/health/documents/community-register/html/h1544.htm | access-date=3 March 2023}}

| legal_UN =

| legal_UN_comment =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action =

| excretion =

| index2_label = as HCl

| CAS_number_Ref =

| CAS_number = 1809010-50-1

| CAS_number2 = 1809010-52-3

| CAS_supplemental =

| PubChem = 137528262

| IUPHAR_ligand =

| DrugBank_Ref =

| DrugBank = DB15982

| ChemSpiderID_Ref =

| ChemSpiderID = 81368516

| UNII_Ref =

| UNII = XZA0KB1BDQ

| UNII2 = 88SH1NBL2B

| KEGG_Ref =

| KEGG = D11673

| KEGG2_Ref =

| KEGG2 = D11674

| ChEBI_Ref =

| ChEBI =

| ChEMBL_Ref =

| ChEMBL =

| NIAID_ChemDB =

| PDB_ligand =

| synonyms = BCX7353, BCX-7353

| IUPAC_name = 2-[3-(aminomethyl)phenyl]-N-[5-[(R)-(3-cyanophenyl)-(cyclopropylmethylamino)methyl]-2-fluorophenyl]-5-(trifluoromethyl)pyrazole-3-carboxamide

| C = 30 | H = 26 | F = 4 | N = 6 | O = 1

| SMILES = NCC1=CC(=CC=C1)N1N=C(C=C1C(=O)NC1=CC(=CC=C1F)[C@H](NCC1CC1)C1=CC=CC(=C1)C#N)C(F)(F)F

| StdInChI = 1S/C30H26F4N6O/c31-24-10-9-22(28(37-17-18-7-8-18)21-5-1-3-19(11-21)15-35)13-25(24)38-29(41)26-14-27(30(32,33)34)39-40(26)23-6-2-4-20(12-23)16-36/h1-6,9-14,18,28,37H,7-8,16-17,36H2,(H,38,41)/t28-/m1/s1

| StdInChI_comment =

| StdInChIKey = UXNXMBYCBRBRFD-MUUNZHRXSA-N

| density =

| density_notes =

| melting_point =

| melting_high =

| melting_notes =

| boiling_point =

| boiling_notes =

| solubility =

| sol_units =

| specific_rotation =

}}

Berotralstat, sold under the brand name Orladeyo, is a medication used to prevent attacks of hereditary angioedema (HAE) in people aged twelve years and older.{{cite journal | vauthors = Hwang JR, Hwang G, Johri A, Craig T | title = Oral plasma kallikrein inhibitor BCX7353 for treatment of hereditary angioedema | journal = Immunotherapy | volume = 11 | issue = 17 | pages = 1439–1444 | date = December 2019 | pmid = 31635497 | doi = 10.2217/imt-2019-0128 | doi-access = free }}{{cite journal | vauthors = Zuraw B, Lumry WR, Johnston DT, Aygören-Pürsün E, Banerji A, Bernstein JA, Christiansen SC, Jacobs JS, Sitz KV, Gower RG, Gagnon R, Wedner HJ, Kinaciyan T, Hakl R, Hanzlíková J, Anderson JT, McNeil DL, Fritz SB, Yang WH, Tachdjian R, Busse PJ, Craig TJ, Li HH, Farkas H, Best JM, Clemons D, Cornpropst M, Dobo SM, Iocca HA, Kargl D, Nagy E, Murray SC, Collis P, Sheridan WP, Maurer M, Riedl MA | display-authors = 6 | title = Oral once-daily berotralstat for the prevention of hereditary angioedema attacks: A randomized, double-blind, placebo-controlled phase 3 trial | journal = The Journal of Allergy and Clinical Immunology | date = October 2020 | volume = 148 | issue = 1 | pages = 164–172.e9 | pmid = 33098856 | doi = 10.1016/j.jaci.2020.10.015 | doi-access = free }}

The most common side effects include abdominal pain, vomiting, diarrhea, back pain, and heartburn.

Berotralstat was approved for medical use in the United States in December 2020,{{cite web | title=Orladeyo: FDA-Approved Drugs | website=U.S. Food and Drug Administration (FDA) | url=https://www.accessdata.fda.gov/scripts/cder/daf/index.cfm?event=overview.process&varApplNo=214094 | access-date=25 December 2020}} and in the European Union in April 2021.