Bibrocathol

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 486407352

| IUPAC_name = 4,5,6,7-tetrabromo-2-hydroxy-1,3,2-benzodioxabismole

| image = Bibrocathol structure a.svg

| tradename = Noviform, Posiformin

| Drugs.com = {{drugs.com|international|bibrocathol}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration = Topical (eye ointment)

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 6915-57-7

| ATC_prefix = S01

| ATC_suffix = AX05

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C6H2Br4O2.Bi.H2O/c7-1-2(8)4(10)6(12)5(11)3(1)9;;/h11-12H;;1H2/q;+3;/p-3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = VTAVFIZOZUAKKE-UHFFFAOYSA-K

| PubChem = 16683103

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 11232581

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 0KJ20H1BLJ

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 44875

| chemical_formula =

| C=6 | H=1 | Bi=1 | Br=4 | O=3

| smiles = O[Bi]1Oc2c(Br)c(Br)c(Br)c(Br)c2O1

| synonyms = Bibrocathin
Tetrabromopyrocatechol bismuth

}}

Bibrocathol (INN; trade names Noviform and Posiformin) is a pharmaceutical antiseptic. Its chemical name is 4,5,6,7-tetrabrom-1,3,2-benzodioxabismol-2-ol. It contains bismuth and is used to treat eye infections and control swelling.{{cite book | vauthors = Gurtler L | chapter = Chapter 2: The Eye and Conjunctiva as Target of Entry for Infectious Agents: Prevention by Protection and by Antiseptic Prophylaxis | veditors = Kramer A, Behrens-Baumann W |title=Antiseptic prophylaxis and therapy in ocular infections: principles, clinical practice, and infection control | series = Developments in Ophthalmology |date= January 2002 | volume = 33 | pages = 9–13 |publisher=Karger |location=Basel |isbn=978-3-8055-7316-0 | doi = 10.1159/000065934 | pmid = 12236131 | chapter-url = https://books.google.com/books?id=JkQOSAnOIhoC&dq=Bibrocathol&pg=PA96 }}