Biricodar
{{short description|Pharmaceutical drug}}
{{cs1 config |name-list-style=vanc |display-authors=6}}
{{Infobox drug
| Watchedfields = changed
| verifiedrevid = 414031157
| IUPAC_name = 1,7-di(pyridin-3-yl)heptan-4-yl (2S)-1-[oxo(3,4,5-trimethoxyphenyl)acetyl]piperidine-2-carboxylate
| image = Biricodar.svg
| tradename =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 174254-13-8
| ATC_prefix = none
| ATC_suffix =
| PubChem = 3037617
| DrugBank =
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 2301309
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 9WQP0L619L
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 350775
| C=34 | H=41
| N=3 | O=7
| smiles = O=C(C(=O)c1cc(OC)c(OC)c(OC)c1)N4[C@H](C(=O)OC(CCCc2cccnc2)CCCc3cccnc3)CCCC4
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C34H41N3O7/c1-41-29-20-26(21-30(42-2)32(29)43-3)31(38)33(39)37-19-5-4-16-28(37)34(40)44-27(14-6-10-24-12-8-17-35-22-24)15-7-11-25-13-9-18-36-23-25/h8-9,12-13,17-18,20-23,27-28H,4-7,10-11,14-16,19H2,1-3H3/t28-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = CGVWPQOFHSAKRR-NDEPHWFRSA-N
}}
Biricodar or incel (INN, codename VX-710) was a pharmaceutical drug under development by Vertex Pharmaceuticals to help treat ovarian cancer patients.{{cite journal | vauthors = Dey S | title = Biricodar. Vertex Pharmaceuticals | journal = Current Opinion in Investigational Drugs | location = London, England | volume = 3 | issue = 5 | pages = 818–23 | date = May 2002 | pmid = 12090559 | doi = }} The drug never reached the market.
References
{{Reflist}}
Further reading
{{refbegin}}
- {{cite journal | vauthors = Nobili S, Landini I, Giglioni B, Mini E | title = Pharmacological strategies for overcoming multidrug resistance | journal = Current Drug Targets | volume = 7 | issue = 7 | pages = 861–79 | date = July 2006 | pmid = 16842217 | doi = 10.2174/138945006777709593 }}
- {{cite journal | vauthors = Toppmeyer D, Seidman AD, Pollak M, Russell C, Tkaczuk K, Verma S, Overmoyer B, Garg V, Ette E, Harding MW, Demetri GD | title = Safety and efficacy of the multidrug resistance inhibitor Incel (biricodar; VX-710) in combination with paclitaxel for advanced breast cancer refractory to paclitaxel | journal = Clinical Cancer Research| volume = 8 | issue = 3 | pages = 670–8 | date = March 2002 | pmid = 11895894 }}
{{refend}}
{{Antineoplastic-drug-stub}}