Bisoxatin
{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 447981139
| IUPAC_name = 2,2-bis(4-hydroxyphenyl)-2H-benzo[b][1,4]oxazin-3(4H)-one
| image = bisoxatin.png
| tradename =
| Drugs.com = {{drugs.com|international|bisoxatin}}
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number = 17692-24-9
| ATC_prefix = A06
| ATC_suffix = AB09
| PubChem = 28689
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 2106004
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 7C75N0L7FP
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 26684
| smiles = O=C1Nc4c(OC1(c2ccc(O)cc2)c3ccc(O)cc3)cccc4
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C20H15NO4/c22-15-9-5-13(6-10-15)20(14-7-11-16(23)12-8-14)19(24)21-17-3-1-2-4-18(17)25-20/h1-12,22-23H,(H,21,24)
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = BPKUDUSVDVLOPY-UHFFFAOYSA-N
| C=20 | H=15 | N=1 | O=4
}}
Bisoxatin (formula: C20H15NO4) is a laxative. It can be synthesized from isatin.Reddy, Srinivas Reddy Desi; Rane, Dnyandev Ragho; Velivela, Srinivas Rao; Peketi, Subbareddy. Preparation of novel polymorphic form - A of bisoxatin acetate. 2013. IN2013CH04892 A.