Bitartrate

{{Chembox

| Name = Bitartrate anion

| ImageFile = Bitartrate.svg

| ImageSize = 180px

| PIN = 3-Carboxy-2,3-dihydroxypropanoate{{cite web |title=3-carboxy-2,3-dihydroxypropanoate (CHEBI:48929) |url=https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:48929 |website=www.ebi.ac.uk |accessdate=27 January 2019 |date=25 June 2014}}{{cite web |title=3-Carboxy-2,3-dihydroxypropanoate {{!}} C4H5O6 {{!}} ChemSpider |url=http://www.chemspider.com/Chemical-Structure.2900154.html |website=www.chemspider.com |accessdate=27 January 2019}}

| OtherNames = {{ubl|Bitartrate|Butanedioic acid, 2,3-dihydroxy-, ion(1−)|3-Carboxylato-2,3-dihydroxypropionic acid|Hydrogen tartrate|2,3,4-Trihydroxy-4-oxobutanoate|2,3,4-Trihydroxy-4-oxobutyric acidanion{{cite web |title=Hydrogen tartrate |url=https://pubchem.ncbi.nlm.nih.gov/compound/3667129#section=IUPAC-Name |website=pubchem.ncbi.nlm.nih.gov |accessdate=27 January 2019}}}}

| Section1 = {{Chembox Identifiers

| ChEBI = 48929

| ChEBI_Comment =

| ChemSpiderID = 2900154

| ChemSpiderID_Comment =

| PubChem = 3667129

| PubChem_Comment =

| SMILES = OC(C(O)C([O-])=O)C(O)=O

| SMILES_Comment =

| SMILES1 = C(C(C(=O)[O-])O)(C(=O)O)O

| SMILES1_Comment =

| StdInChI = 1S/C4H6O6/c5-1(3(7)8)2(6)4(9)10/h1-2,5-6H,(H,7,8)(H,9,10)/p-1

| StdInChI_Comment =

| StdInChIKey = FEWJPZIEWOKRBE-UHFFFAOYSA-M

| Beilstein = 3905887

}}

| Section2 = {{Chembox Properties

| C=4 | H=5 | O=6

| Formula_Charge = −

| ConjugateAcid = Tartaric acid

| ConjugateBase = Tartrate

}}

}}

Bitartrate is an anion which is the conjugate base of tartaric acid. It may also refer to any salt or monoester of tartaric acid.

Some examples of bitartrate salts include:

References