Bornesitol

{{Chembox

| Watchedfields = changed

| verifiedrevid = 443426693

| ImageFile = Bornesitol.svg

| ImageSize = 150px

| IUPACName = 1D-1-O-Methyl-myo-inositol

| SystematicName = (1R,2R,3S,4S,5R,6S)-6-Methoxycyclohexane-1,2,3,4,5-pentol

| OtherNames = D-(−)-Bornesitol

|Section1={{Chembox Identifiers

| CASNo = 484-71-9

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = RW8AP5YP8U

| PubChem = 440078

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 10254649

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 18427

| KEGG = C03659

| SMILES = O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](OC)[C@H](O)[C@H]1O

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI=1S/C7H14O6/c1-13-7-5(11)3(9)2(8)4(10)6(7)12/h2-12H,1H3/t2-,3-,4+,5-,6-,7-/m1/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = DSCFFEYYQKSRSV-AGZHHQKVSA-N

}}

|Section2={{Chembox Properties

| C=7 | H=14 | O=6

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Bornesitol is a cyclitol. It can be found in the gentianaceae and menyanthaceae plant families.{{cite journal | doi = 10.1016/S0031-9422(00)94463-7 | title = Distribution of l-(+)-bornesitol in the gentianaceae and menyanthaceae | author = Norbert Schilling | journal = Phytochemistry | volume = 15 | issue = 5 | year = 1976 | pages = 824–826| bibcode = 1976PChem..15..824S }}{{dead link|date=March 2019|bot=medic}}{{cbignore|bot=medic}} Chemically, it is a methyl ether of D-myo-inositol.