Bromsulfthalein

{{chembox

| Verifiedfields = changed

| verifiedrevid = 401936100

| ImageFile = Bromsulphthalein.png

| ImageSize =

| PIN = Disodium 3,3′-(4,5,6,7-tetrabromo-3-oxo-2-benzofuran-1,1(3H)-diyl)bis(6-hydroxybenzene-1-sulfonate)

| OtherNames = Bromsulphthalein; Bromosulfophthalein; Bromosulphophthalein; BSP; Sulfobromophthalein

|Section1={{Chembox Identifiers

| IUPHAR_ligand = 4506

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 6046

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 62E5JU30OV

| InChI = 1/C20H10Br4O10S2.2Na/c21-15-13-14(16(22)18(24)17(15)23)20(34-19(13)27,7-1-3-9(25)11(5-7)35(28,29)30)8-2-4-10(26)12(6-8)36(31,32)33;;/h1-6,25-26H,(H,28,29,30)(H,31,32,33);;/q;2*+1/p-2

| InChIKey = GHAFORRTMVIXHS-NUQVWONBAX

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C20H10Br4O10S2.2Na/c21-15-13-14(16(22)18(24)17(15)23)20(34-19(13)27,7-1-3-9(25)11(5-7)35(28,29)30)8-2-4-10(26)12(6-8)36(31,32)33;;/h1-6,25-26H,(H,28,29,30)(H,31,32,33);;/q;2*+1/p-2

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = GHAFORRTMVIXHS-UHFFFAOYSA-L

| CASNo = 71-67-0

| CASNo_Ref = {{cascite|correct|CAS}}

| PubChem = 6282

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 453904

| SMILES = [Na+].[Na+].[O-]S(=O)(=O)c1c(O)ccc(c1)C3(OC(=O)c2c(Br)c(Br)c(Br)c(Br)c23)c4ccc(O)c(c4)S([O-])(=O)=O

}}

|Section2={{Chembox Properties

| C=20 | H=8 | O=10 | Br=4 | S=2 | Na=2

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section6={{Chembox Pharmacology

| ATCCode_prefix = V04

| ATCCode_suffix = CE02

}}

|Section7={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Bromsulfthalein (also known as bromsulphthalein, bromosulfophthalein, and BSP) is a phthalein dye used in liver function tests. Determining the rate of removal of the dye from the blood stream gives a measure of liver function.{{cite journal | doi = 10.1001/jama.1925.02660410020008| title = Clinical Application of the Bromsulphalein Test for Hepatic Function| journal = JAMA: The Journal of the American Medical Association| volume = 84| issue = 15| pages = 1112| year = 1925| last1 = Rosenthal| first1 = Sanford M.}} The mechanism by which the liver detoxifies BSP is to attach it to glutathione which is the body’s master antioxidant.