Buclizine

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 459985078

| IUPAC_name = (RS)-1-[(4-chlorophenyl)- phenyl-methyl]-4- [(4-tert-butylphenyl) methyl] piperazine

| image = Buclizine.svg

| width = 280px

| chirality = Racemic mixture

| tradename =

| Drugs.com = {{drugs.com|CONS|buclizine}}

| IUPHAR_ligand = 7134

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 82-95-1

| ATC_prefix = R06

| ATC_suffix = AE01

| PubChem = 6729

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB00354

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 6473

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 0C94V6X681

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 3205

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1201271

| C=28 | H=33 | Cl=1 | N=2

| smiles = Clc1ccc(cc1)C(c2ccccc2)N3CCN(CC3)Cc4ccc(cc4)C(C)(C)C

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C28H33ClN2/c1-28(2,3)25-13-9-22(10-14-25)21-30-17-19-31(20-18-30)27(23-7-5-4-6-8-23)24-11-15-26(29)16-12-24/h4-16,27H,17-21H2,1-3H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = MOYGZHXDRJNJEP-UHFFFAOYSA-N

}}

Buclizine is an antihistamine and anticholinergic of the diphenylmethylpiperazine group. It is considered to be an antiemetic, similar to meclizine.{{cite book | vauthors = Mostafa GA, Al-Badr AA | title = Buclizine | journal = Profiles of Drug Substances, Excipients, and Related Methodology | volume = 36 | pages = 1–33 | year = 2011 | pmid = 22469258 | doi = 10.1016/B978-0-12-387667-6.00001-4 | series = Profiles of Drug Substances, Excipients and Related Methodology | isbn = 9780123876676 }}

In the United Kingdom, buclizine is one of three drugs contained in Migraleve tablets, marketed by McNeil Healthcare for migraines.{{cite journal | vauthors = Behrendt WA, Cserepes J | title = Acute toxicity and analgesic action of a combination of buclizine, codeine and paracetamol ('Migraleve') in tablet and suppository form in rats | journal = Pharmatherapeutica | volume = 4 | issue = 5 | pages = 322–31 | year = 1985 | pmid = 4070325 }}