Butachlor

{{Chembox

| ImageFile = butachlor structure.svg

| ImageSize =

| PIN = N-(Butoxymethyl)-2-chloro-N-(2,6-diethylphenyl)acetamide

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 23184-66-9

| CASNo_Ref = {{cascite|correct|CAS}}

| PubChem = 31677

| ChEMBL = 1399036

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 3230

| ChemSpiderID = 29376

| EINECS = 245-477-8

| KEGG = C10931

| UNII = 94NU90OO5K

| SMILES = ClCC(=O)N(c1c(cccc1CC)CC)COCCCC

| InChI =1S/C17H26ClNO2/c1-4-7-11-21-13-19(16(20)12-18)17-14(5-2)9-8-10-15(17)6-3/h8-10H,4-7,11-13H2,1-3H3

}}

|Section2={{Chembox Properties

| Properties_ref = Merck Index, 11th Edition, 1498

| C=17 | H=26 | Cl=1 | N=1 | O=2

| Appearance = Light yellow oil

| Density = 1.0695 g/cm3

| MeltingPt =

| BoilingPt =

| Solubility = 20 mg/L (20 °C)

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPtC = 100

| FlashPt_ref = [http://www.sigmaaldrich.com/catalog/ProductDetail.do?N4=37887|sial&N5=SEARCH_CONCAT_PNO|BRAND_KEY&F=SPEC Butachlor] at Sigma-Aldrich

| AutoignitionPt =

| GHSPictograms = {{GHS06}}{{GHS07}}{{GHS09}}

| GHSSignalWord = Danger

| HPhrases = {{H-phrases|302|317|331|410}}

| PPhrases = {{P-phrases|261|264|270|271|272|273|280|301+312|302+352|304+340|311|321|330|333+313|363|391|403+233|405|501}}

| LD50 = 1740 mg/kg (oral, rat)

}}

}}

Butachlor is a herbicide of the acetanilide class.{{citation | url = https://sitem.herts.ac.uk/aeru/ppdb/en/Reports/101.htm | title = PPDB| access-date = 2019-10-03}}. It is used as a selective pre-emergent herbicide to control annual grasses and some broad-leaved weeds. It was introduced circa 1970.[https://sitem.herts.ac.uk/aeru/ppdb/en/Reports/101.htm PPDB], retrieved 1-2025-March It is extensively used in India in the form of granules and emulsifiable concentrate in rice as post emergence herbicide, and {{convert|2699|t|lb}} was sold in India in 2005-06, declining to {{convert|372|t|lb}} in 2009-10.Choudhury PP, Singh R, Ghosh D and Sharma AR. 2016. Herbicide Use in Indian Agriculture. ICAR - Directorate of Weed Research, Jabalpur, Madhya Pradesh, 110 p. https://dwr.icar.gov.in/Downloads/Information_Bulletin/Information%20Bulletin%20No%20-%2022%20-%20Herbicide%20Use%20in%20Indian%20Agriculture.pdf

Butachlor's herbicide mode of action is to prevent formation of very long chain fatty acids; this makes its HRAC classification group J (Australia), K3 (global) and 15 (numeric).

Application

Butachlor is typically applied at 1.25-2 kg/ha active ingredient.

References

{{reflist}}

Links

  • {{PPDB|101}}

{{herbicides}}

{{Aniline Herbicides}}

Category:Herbicides

Category:Acetanilides

Category:Butyl compounds

Category:Group 15 herbicides

{{organic-compound-stub}}