Butopamine
{{cs1 config|name-list-style=vanc|display-authors=6}}
{{Infobox drug
| drug_name =
| image = Butopamine.svg
| width =
| caption =
| pronounce =
| tradename =
| Drugs.com =
| MedlinePlus =
| licence_CA =
| licence_EU =
| DailyMedID =
| licence_US =
| pregnancy_AU =
| pregnancy_category =
| dependency_liability =
| addiction_liability =
| routes_of_administration =
| class = Sympathomimetic; β-Adrenergic receptor agonist; Positive inotrope; Positive chronotrope
| ATC_prefix =
| ATC_suffix =
| legal_status =
| bioavailability =
| protein_bound =
| metabolism =
| metabolites =
| onset =
| elimination_half-life =
| duration_of_action =
| excretion =
| CAS_number = 66734-12-1
| CAS_supplemental =
| PubChem = 68556
| IUPHAR_ligand =
| DrugBank =
| ChemSpiderID = 61830
| UNII = ZX7907IE2H
| KEGG = D03195
| ChEBI = 82648
| ChEMBL = 2103767
| NIAID_ChemDB =
| PDB_ligand =
| synonyms = {{ubl|LY-131126|(R,R)-Ractopamine}}
| IUPAC_name = 4-[(3R)-3-
| C=18 | H=23 | N=1 | O=3
| SMILES = C[C@H](CCC1=CC=C(C=C1)O)NC[C@@H](C2=CC=C(C=C2)O)O
| StdInChI = 1S/C18H23NO3/c1-13(2-3-14-4-8-16(20)9-5-14)19-12-18(22)15-6-10-17(21)11-7-15/h4-11,13,18-22H,2-3,12H2,1H3/t13-,18+/m1/s1
| StdInChIKey = YJQZYXCXBBCEAQ-ACJLOTCBSA-N
}}
Butopamine ({{Abbrlink|INN|International Nonproprietary Name}}, {{Abbrlink|USAN|United States Adopted Name}}; developmental code name LY-131126; also known as (R,R)-ractopamine) is a sympathomimetic agent, β-adrenergic receptor agonist, and positive inotrope of the phenethylamine family which was studied for treatment of heart failure but was never marketed.{{cite book | vauthors = Elks J | title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies | publisher=Springer US | year=2014 | isbn=978-1-4757-2085-3 | url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA199 | access-date=27 February 2025 | page=199}}{{cite book | vauthors = Morton IK, Hall JM | title=Concise Dictionary of Pharmacological Agents: Properties and Synonyms | publisher=Springer Netherlands | year=2012 | isbn=978-94-011-4439-1 | url=https://books.google.com/books?id=tsjrCAAAQBAJ&pg=PA58 | access-date=27 February 2025 | page=58}}{{cite book | vauthors = Hess HJ | title=Annual Reports in Medicinal Chemistry | publisher=Academic Press | issue=v. 16 | year=1981 | isbn=978-0-08-058360-0 | url=https://books.google.com/books?id=LVISmUSjD0cC&pg=PA96 | access-date=27 February 2025 | page=96}}{{cite journal | vauthors = Chatterjee K | title = Recent advances in the management of chronic heart failure | journal = Prim Care | volume = 12 | issue = 1 | pages = 117–142 | date = March 1985 | pmid = 3846305 | doi = 10.1016/S0095-4543(21)01244-6 | url = }} It is an analogue of dobutamine and is the (R,R)-enantiomer of ractopamine. Butopamine is not a catecholamine and is resistant to metabolism by catechol O-methyltransferase (COMT). In contrast to dobutamine, butopamine is orally active. In addition to its positive inotropic effects, butopamine has positive chronotropic effects.
References
{{Reflist}}
{{Adrenergic receptor modulators}}
{{Phenethylamines}}
Category:Beta-adrenergic agonists
Category:Drugs developed by Eli Lilly and Company
Category:4-Hydroxyphenyl compounds
{{Cardiovascular-drug-stub}}