Butyl methacrylate

{{Chembox

| ImageFile = Butylmethacrylaat.png

| ImageSize =

| ImageAlt =

| PIN = Butyl 2-methylprop-2-enoate

| OtherNames = Butyl 2-methylpropenoate, Acryester B, Acryester BMA, n-butyl methacrylate

|Section1={{Chembox Identifiers

| CASNo = 97-88-1

| PubChem = 7354

| ChemSpiderID = 7076

| EC_number = 202-615-1

| RTECS = OZ3675000

| UNNumber = 2227

| UNII = R5QX287XXU

| ChEMBL = 3183073

| DTXSID = DTXSID4024696

| StdInChI=1S/C8H14O2/c1-4-5-6-10-8(9)7(2)3/h2,4-6H2,1,3H3

| StdInChIKey = SOGAXMICEFXMKE-UHFFFAOYSA-N

| SMILES = CCCCOC(=O)C(=C)C

}}

|Section2={{Chembox Properties

| C=8|H=14|O=2

| MolarMass =

| Appearance = colorless liquid

| Density = 0.8936 g/cm³

| MeltingPtC = -25

| BoilingPtC = 160

}}

|Section3={{Chembox Hazards

| GHSPictograms = {{GHS02}}{{GHS07}}

| GHSSignalWord = Danger

| HPhrases = {{H-phrases|226|315|317|319|335}}

| PPhrases = {{P-phrases|210|233|240|241|242|243|261|264|271|272|280|302+352|303+361+353|304+340|305+351+338|312|321|332+313|333+313|337+313|362|363|370+378|403+233|403+235|405|501}}

| MainHazards =

| FlashPtC = 50

| NFPA-H = 1

| NFPA-F = 2

| NFPA-R = 2

| AutoignitionPtC = 290

}}

}}

Butyl methacrylate is the organic compound with the formula C₄H₉O₂CC(CH₃)=CH₂. A colorless liquid, it is a common monomer for the preparation of methacrylate polymers.{{Ullmann|first1=William|last1=Bauer, Jr.|title=Methacrylic Acid and Derivatives|year=2002|doi=10.1002/14356007.a16_441}}. It is typically polymerized under free-radical conditions.{{cite journal|title=Controlled Radical Polymerization of Methacrylic Monomers in the Presence of a Bis(ortho-chelated) Arylnickel(II) Complex and Different Activated Alkyl Halides|last1=Granel, C.|last2=Dubois |first2=Ph.|last3=Jérôme |first3=R.|last4=Teyssié |first4=Ph.|journal=Macromolecules|year=1996|volume=29|issue=27|pages=8576–8582|doi=10.1021/ma9608380|bibcode=1996MaMol..29.8576G}}