Butyltolylquinuclidine

{{Short description|Stimulant drug}}

{{Drugbox

| verifiedrevid = 424688456

| IUPAC_name = (2R,3S,4S)-2-butyl-3-p-tolylquinuclidine

| image = Butyltolylquinuclidine Structure.svg

| alt = Skeletal formula of butyltolylquinuclidine

| image2 = Butyltolylquinuclidine molecule ball.png

| alt2 = Ball-and-stick model of the butyltolylquinuclidine molecule

| width2 = 200

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status = Legal

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 328047-48-9

| ATC_prefix = none

| ATC_suffix =

| PubChem = 9903250

| ChemSpiderID = 8013735

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| UNII = J5W6BTT4ZQ

| C=18 | H=27 | N=1

| smiles = C3CC1CCN3C(CCCC)C1c(cc2)ccc2C

| StdInChI=1S/C18H27N/c1-3-4-5-17-18(15-8-6-14(2)7-9-15)16-10-12-19(17)13-11-16/h6-9,16-18H,3-5,10-13H2,1-2H3

| StdInChIKey = QYIZEJQSBLRXJK-UHFFFAOYSA-N

}}

2-Butyl-3-(p-tolyl)quinuclidine (BTQ) is a stimulant DRI.{{cite journal | vauthors = Sakamuri S, Enyedy IJ, Zaman WA, Tella SR, Kozikowski AP, Flippen-Anderson JL, Farkas T, Johnson KM, Wang S | display-authors = 6 | title = 2,3-Disubstituted quinuclidines as a novel class of dopamine transporter inhibitors | journal = Bioorganic & Medicinal Chemistry | volume = 11 | issue = 6 | pages = 1123–36 | date = March 2003 | pmid = 12614900 | doi = 10.1016/S0968-0896(02)00450-9 }} It is one of a number of substituted quinuclidine derivatives developed as potential medications for the treatment of cocaine abuse,{{cite journal | vauthors = Enyedy IJ, Sakamuri S, Zaman WA, Johnson KM, Wang S | title = Pharmacophore-based discovery of substituted pyridines as novel dopamine transporter inhibitors | journal = Bioorganic & Medicinal Chemistry Letters | volume = 13 | issue = 3 | pages = 513–7 | date = February 2003 | pmid = 12565962 | doi = 10.1016/S0960-894X(02)00943-5 }} and produces similar effects to cocaine in animal studies, although milder and longer-lasting.