C-8813

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 418055998

| IUPAC_name = trans-4-(p-Bromophenyl)-4-(dimethylamino)-1-(2-(thiophen-2-yl)ethyl)cyclohexanol

| image = C-8813.svg

| image_class = skin-invert-image

| width = 200px

| image2 = C-8813 3D BS.png

| image_class2 = bg-transparent

| width2 = 200px

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 616898-54-5

| ATC_prefix =

| ATC_suffix =

| PubChem = 11058633

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = D343S4VX5G

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 48059007

| C=20 | H=26 | Br=1 | N=1 | O=1 | S=1

| smiles = BrC1=CC=C([C@@]2(CC[C@](CC2)(CCC3=CC=CS3)O)N(C)C)C=C1

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C20H26BrNOS/c1-22(2)20(16-5-7-17(21)8-6-16)13-11-19(23,12-14-20)10-9-18-4-3-15-24-18/h3-8,15,23H,9-14H2,1-2H3/t19-,20-

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = XRDNIYBVNZLPJE-MXVIHJGJSA-N

| synonyms =

}}

C-8813 (thiobromadol) is a potent μ-opioid receptor agonist with a distinctive chemical structure which is not closely related to other established families of opioid drugs. The trans-isomer was found to be around 591 times more potent than morphine in animal studies.{{cite journal | vauthors = Liu ZH, Jin WQ, Dai QY, Chen XJ, Zhang HP, Chi ZQ | title = Opioid activity of C8813, a novel and potent opioid analgesic | journal = Life Sciences | volume = 73 | issue = 2 | pages = 233–41 | date = May 2003 | pmid = 12738037 | doi = 10.1016/S0024-3205(03)00263-7 }} The same study assigned a potency of 504 times that of morphine to the related compound BDPC.

C-8813 is claimed to be similarly potent at the δ-opioid receptor, which antagonizes the μ-induced depression of breathing, presumably making the drug safer.

C-8813 has never been approved for use in humans.{{cn|date=October 2023}}