CA-170

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{Infobox drug

| drug_name =

| INN =

| type =

| image = CA-170.svg

| width =

| alt =

| caption =

| image2 =

| width2 =

| alt2 =

| caption2 =

| imageL =

| widthL =

| altL =

| imageR =

| widthR =

| altR =

| captionLR =

| pronounce =

| tradename =

| Drugs.com =

| MedlinePlus =

| licence_CA =

| licence_EU =

| DailyMedID =

| licence_US =

| pregnancy_AU =

| pregnancy_AU_comment =

| pregnancy_category=

| dependency_liability =

| addiction_liability =

| routes_of_administration =

| class =

| ATCvet =

| ATC_prefix =

| ATC_suffix =

| ATC_supplemental =

| legal_AU =

| legal_AU_comment =

| legal_BR =

| legal_BR_comment =

| legal_CA =

| legal_CA_comment =

| legal_DE =

| legal_DE_comment =

| legal_NZ =

| legal_NZ_comment =

| legal_UK =

| legal_UK_comment =

| legal_US =

| legal_US_comment =

| legal_EU =

| legal_EU_comment =

| legal_UN =

| legal_UN_comment =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action=

| excretion =

| CAS_number = 1673534-76-3

| CAS_supplemental =

| PubChem = 126843231

| PubChemSubstance =

| IUPHAR_ligand =

| DrugBank = DB15772

| ChemSpiderID = 68025713

| UNII = 646MN6KQ16

| KEGG =

| ChEBI =

| ChEMBL = 5411171

| NIAID_ChemDB =

| PDB_ligand =

| synonyms =

| IUPAC_name = (2S,3R)-2-[[(1S)-3-amino-1-[3-[(1R)-1-amino-2-hydroxyethyl]-1,2,4-oxadiazol-5-yl]-3-oxopropyl]carbamoylamino]-3-hydroxybutanoic acid

| C=12 | H=20 | N=6 | O=7

| molecular_weight =

| SMILES = C[C@H]([C@@H](C(=O)O)NC(=O)N[C@@H](CC(=O)N)C1=NC(=NO1)[C@H](CO)N)O

| Jmol =

| StdInChI = 1S/C12H20N6O7/c1-4(20)8(11(22)23)16-12(24)15-6(2-7(14)21)10-17-9(18-25-10)5(13)3-19/h4-6,8,19-20H,2-3,13H2,1H3,(H2,14,21)(H,22,23)(H2,15,16,24)/t4-,5+,6+,8+/m1/s1

| StdInChI_comment =

| StdInChIKey = HFOBENSCBRZVSP-LKXGYXEUSA-N

| density =

| density_notes =

| melting_point =

| melting_high =

| melting_notes =

| boiling_point =

| boiling_notes =

| solubility =

| sol_units =

| specific_rotation =

}}

CA-170 is an investigational new drug being evaluated as an immune checkpoint inhibitor for the treatment of cancer. Developed by Aurigene Oncology, it is an orally available small molecule designed to selectively inhibit the immune checkpoint proteins PD-L1{{cite journal | vauthors = Sasikumar PG, Ramachandra M | title = Small Molecule Agents Targeting PD-1 Checkpoint Pathway for Cancer Immunotherapy: Mechanisms of Action and Other Considerations for Their Advanced Development | journal = Frontiers in Immunology | volume = 13 | issue = | pages = 752065 | date = 2022 | pmid = 35585982 | pmc = 9108255 | doi = 10.3389/fimmu.2022.752065 | doi-access = free | url = }} and VISTA,{{cite journal | vauthors = Wu C, Cao X, Zhang X | title = VISTA inhibitors in cancer immunotherapy: a short perspective on recent progresses | journal = RSC Medicinal Chemistry | volume = 12 | issue = 10 | pages = 1672–1679 | date = October 2021 | pmid = 34778768 | pmc = 8528208 | doi = 10.1039/d1md00185j | url = }} both of which are key negative regulators of T-cell activation implicated in cancer immune evasion.{{Cite web |url=https://www.curis.com/pipeline/ca-170/ |title=CA‑170 |website=Curis, Inc |access-date=2025-06-22}}{{cite journal | vauthors = Sasikumar PG, Sudarshan NS, Adurthi S, Ramachandra RK, Samiulla DS, Lakshminarasimhan A, Ramanathan A, Chandrasekhar T, Dhudashiya AA, Talapati SR, Gowda N, Palakolanu S, Mani J, Srinivasrao B, Joseph D, Kumar N, Nair R, Atreya HS, Gowda N, Ramachandra M | title = PD-1 derived CA-170 is an oral immune checkpoint inhibitor that exhibits preclinical anti-tumor efficacy | journal = Communications Biology | volume = 4 | issue = 1 | pages = 699 | date = June 2021 | pmid = 34103659 | pmc = 8187357 | doi = 10.1038/s42003-021-02191-1 }}

By targeting these immune pathways, CA-170 aims to restore and enhance the immune system’s ability to recognize and eliminate tumor cells, offering the potential for improved anti-tumor responses across a variety of cancers.{{cite journal | vauthors = Lee JJ, Powderly JD, Patel MR, Brody J, Hamilton EP, Infante JR, Falchook GS, Wang H, Adams L, Gong L, Ma AW | title = Phase 1 trial of CA-170, a novel oral small molecule dual inhibitor of immune checkpoints PD-1 and VISTA, in patients (pts) with advanced solid tumor or lymphomas | journal = Journal of Clinical Oncology | date = 2017 | volume = 35 | issue = 15 suppl | pages = TPS3099 | doi = 10.1200/JCO.2017.35.15_suppl.TPS3099 }}