CA77.1

{{Short description|Chemical compound}}

{{Drugbox

| image = File:CA77-1_structure.png

| alt = Solid

| drug_name = CA77.1

| IUPAC_name = N-[4-(6-chloroquinoxalin-2-yl)phenyl]acetamide

| pregnancy_category =

| legal_status =

| bioavailability =

| metabolism =

| excretion =

| CAS_number = 2412270-22-3

| CAS_number_Ref = {{Cascite|changed|ChemSpider}}

| PubChem = 146439211

| ChemSpiderID = 114641988

| ChEMBL =

| ChEBI =

| UNII =

| C = 16

| H = 12

| Cl = 1

| N = 3

| O = 1

| smiles = CC(=O)NC1=CC=C(C=C1)C2=CN=C3C=C(C=CC3=N2)Cl

| StdInChI = 1S/C16H12ClN3O/c1-10(21)19-13-5-2-11(3-6-13)16-9-18-15-8-12(17)4-7-14(15)20-16/h2-9H,1H3,(H,19,21)

| StdInChIKey = ZQXMPDVGBWOTBY-UHFFFAOYSA-N

}}

CA77.1 (CA) is a synthetic compound that activates chaperone-mediated autophagy (CMA) by increasing the expression of the lysosomal receptor for this pathway, LAMP2A, in lysosomes. CA77.1 is a derivative of earlier compound AR7(HY-101106), which shows potent CMA activation in vitro but is not suitable for in vivo use.{{cite journal | vauthors = Anguiano J, Garner TP, Mahalingam M, Das BC, Gavathiotis E, Cuervo AM | title = Chemical modulation of chaperone-mediated autophagy by retinoic acid derivatives | journal = Nature Chemical Biology | volume = 9 | issue = 6 | pages = 374–82 | date = June 2013 | pmid = 23584676 | pmc = 3661710 | doi = 10.1038/nchembio.1230 }}{{cite patent | country = US | number = 9512092 | inventor = Cuervo AM, Gavathiotis E, Xin Q, Das BC | assign1 = Albert Einstein College of Medicine of Yeshiva | title = Retinoic acid receptor antagonists as chaperone-mediated autophagy modulators and uses thereof | pubdate = 18 June 2015 }}{{cite patent | country = WO | number = 2020077024 | inventor = Cuervo AM, Gavathiotis E | assign1 = Albert Einstein College of Medicine of Yeshiva| title = Benzoxazole and related compounds useful as chaperone-mediated autophagy modulators | pubdate = 16 April 2020 }} CA77.1 is able to activate CMA in vivo, and demonstrates brain penetrance and favorable pharmacokinetics. It has been shown in animal studies that in vivo administration of CA77.1 to enhance chaperone-mediated autophagy, may help to degrade toxic pathogenic protein products such as tau proteins and has potential applications in the treatment of Alzheimer's disease{{cite journal | vauthors = Bourdenx M, Martín-Segura A, Scrivo A, Rodriguez-Navarro JA, Kaushik S, Tasset I, Diaz A, Storm NJ, Xin Q, Juste YR, Stevenson E, Luengo E, Clement CC, Choi SJ, Krogan NJ, Mosharov EV, Santambrogio L, Grueninger F, Collin L, Swaney DL, Sulzer D, Gavathiotis E, Cuervo AM | display-authors = 6 | title = Chaperone-mediated autophagy prevents collapse of the neuronal metastable proteome | journal = Cell | volume = 184| issue = 10| pages = 2696–2714.e25| date = April 2021 | pmid = 33891876 | doi = 10.1016/j.cell.2021.03.048 | pmc = 8152331 }}{{Cite web|url=https://patentscope.wipo.int/search/en/detail.jsf?docId=WO2020046335|title=WIPO - Search International and National Patent Collections|website=patentscope.wipo.int}} particularly in improving both behavior and neuropathology in PS19 mice models.