CAPS (buffer)

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 428751681

| Reference=[http://www.sigmaaldrich.com/catalog/ProductDetail.do?N4=C2632|SIGMA&N5=SEARCH_CONCAT_PNO|BRAND_KEY&F=SPEC CAPS] at Sigma-Aldrich

| Name=CAPS

| ImageFile=CAPS buffer.png

| PIN=3-(Cyclohexylamino)propane-1-sulfonic acid

| OtherNames=

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo=1135-40-6

| PubChem=70815

| DrugBank = DB02219

| EC_number = 214-492-1

| UNII = 4W981O1LXP

| SMILES=C1CCC(CC1)NCCCS(=O)(=O)O

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 63979

| InChI = 1/C9H19NO3S/c11-14(12,13)8-4-7-10-9-5-2-1-3-6-9/h9-10H,1-8H2,(H,11,12,13)

| InChIKey = PJWWRFATQTVXHA-UHFFFAOYAU

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C9H19NO3S/c11-14(12,13)8-4-7-10-9-5-2-1-3-6-9/h9-10H,1-8H2,(H,11,12,13)

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = PJWWRFATQTVXHA-UHFFFAOYSA-N

}}

|Section2={{Chembox Properties

| Formula=C₉H₁₉NO₃S

| MolarMass=221.32 g/mol

| Appearance=

| Density=

| MeltingPt= >300 °C

| BoilingPt=

| Solubility=

| pKa = 10.4{{cite journal | last1 = Esplin | first1 = Taran L. | last2 = Cable | first2 = Morgan L. | last3 = Gray | first3 = Harry B. | last4 = Ponce | first4 = Adrian | title = Terbium-Macrocycle Complexes as Chemical Sensors: Detection of an Aspirin Metabolite in Urine Using a Salicylurate-Specific Receptor Site | journal = Inorganic Chemistry | date = 2010 | volume = 49 | issue = 10 | pages = 4643–4647 | doi = 10.1021/ic1003066}}
{{cite journal | last1 = Tabata | first1 = Masaaki | last2 = Habib | first2 = Ahsan | last3 = Watanabe | first3 = Keiichi | title = DNA Cleavage by Good’s Buffers in the Presence of Au(III) | journal = Bulletin of the Chemical Society of Japan | date = 2005 | volume = 78 | issue = 7 | pages = 1263–1269 | doi = 10.1246/bcsj.78.1263}}

}}

|Section3={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

| GHSPictograms = {{GHS07}}

| GHSSignalWord = Warning

| HPhrases = {{H-phrases|302|315|319|335}}

| PPhrases = {{P-phrases|261|264|270|271|280|301+312|302+352|304+340|305+351+338|312|321|330|332+313|337+313|362|403+233|405|501}}

}}

}}

CAPS is the common name for 3-(Cyclohexylamino)-1-propanesulfonic acid, a chemical used as buffering agent in biochemistry. The similar substance N-cyclohexyl-2-hydroxyl-3-aminopropanesulfonic acid (CAPSO) is also used as buffering agent in biochemistry. Its useful pH range is 9.7-11.1.