CGP-37849

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 402321381

| IUPAC_name = (E,2R)-2-amino-4-methyl-5-phosphonopent-3-enoic acid

| image = CGP-37849.svg

| width = 240

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 137424-81-8

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 76IND1BS43

| ATC_prefix =

| ATC_suffix =

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 29811

| PubChem = 6604869

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 5037128

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C6H12NO5P/c1-4(3-13(10,11)12)2-5(7)6(8)9/h2,5H,3,7H2,1H3,(H,8,9)(H2,10,11,12)/b4-2+/t5-/m1/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = BDYHNCZIGYIOGJ-XWCPEMDWSA-N

| C=6 | H=12 | N=1 | O=5 | P=1

| smiles = C/C(=C\[C@H](C(=O)O)N)/CP(=O)(O)O

| synonyms = CGP-37849, CGP-40116

}}

CGP-37849 is a competitive antagonist at the NMDA receptor.{{cite journal | vauthors = Fagg GE, Olpe HR, Pozza MF, Baud J, Steinmann M, Schmutz M, Portet C, Baumann P, Thedinga K, Bittiger H | display-authors = 6 | title = CGP 37849 and CGP 39551: novel and potent competitive N-methyl-D-aspartate receptor antagonists with oral activity | journal = British Journal of Pharmacology | volume = 99 | issue = 4 | pages = 791–7 | date = April 1990 | pmid = 1972895 | pmc = 1917531 | doi = 10.1111/j.1476-5381.1990.tb13008.x }} It is a potent, orally active anticonvulsant in animal models,{{cite journal | vauthors = Schmutz M, Portet C, Jeker A, Klebs K, Vassout A, Allgeier H, Heckendorn R, Fagg GE, Olpe HR, van Riezen H | display-authors = 6 | title = The competitive NMDA receptor antagonists CGP 37849 and CGP 39551 are potent, orally-active anticonvulsants in rodents | journal = Naunyn-Schmiedeberg's Archives of Pharmacology | volume = 342 | issue = 1 | pages = 61–6 | date = July 1990 | pmid = 1976233 | doi = 10.1007/bf00178973 | s2cid = 25531153 }} and was researched for the treatment of epilepsy.{{cite journal | vauthors = Fujikawa DG, Daniels AH, Kim JS | title = The competitive NMDA receptor antagonist CGP 40116 protects against status epilepticus-induced neuronal damage | journal = Epilepsy Research | volume = 17 | issue = 3 | pages = 207–19 | date = March 1994 | pmid = 7912191 | doi = 10.1016/0920-1211(94)90051-5 | s2cid = 13656613 }} It also has neuroprotective activity{{cite journal | vauthors = Gutnikov SA, Gaffan D | title = Systemic NMDA receptor antagonist CGP-40116 does not impair memory acquisition but protects against NMDA neurotoxicity in rhesus monkeys | journal = The Journal of Neuroscience | volume = 16 | issue = 12 | pages = 4041–5 | date = June 1996 | pmid = 8656297 | pmc = 6578604 | doi = 10.1523/JNEUROSCI.16-12-04041.1996 }} and shows antidepressant{{cite journal | vauthors = Maj J, Klimek V, Gołembiowska K, Rogóz Z, Skuza G | title = Central effects of repeated treatment with CGP 37849, a competitive NMDA receptor antagonist with potential antidepressant activity | journal = Polish Journal of Pharmacology | volume = 45 | issue = 5–6 | pages = 455–66 | pmid = 7912134 | year = 1993 }}{{cite journal | vauthors = Papp M, Moryl E | title = Antidepressant activity of non-competitive and competitive NMDA receptor antagonists in a chronic mild stress model of depression | journal = European Journal of Pharmacology | volume = 263 | issue = 1–2 | pages = 1–7 | date = September 1994 | pmid = 7821340 | doi = 10.1016/0014-2999(94)90516-9 }} and anxiolytic effects.{{cite journal | vauthors = Jessa M, Nazar M, Bidzinski A, Plaznik A | title = The effects of repeated administration of diazepam, MK-801 and CGP 37849 on rat behavior in two models of anxiety | journal = European Neuropsychopharmacology | volume = 6 | issue = 1 | pages = 55–61 | date = March 1996 | pmid = 8866939 | doi = 10.1016/0924-977x(95)00068-z | s2cid = 45953054 }}{{cite journal | vauthors = Przegaliński E, Tatarczyńska E, Chojnacka-Wójcik E | title = The influence of the benzodiazepine receptor antagonist flumazenil on the anxiolytic-like effects of CGP 37849 and ACPC in rats | journal = Neuropharmacology | volume = 39 | issue = 10 | pages = 1858–64 | date = July 2000 | pmid = 10884566 | doi = 10.1016/s0028-3908(00)00023-x | s2cid = 33660694 }}