CGS-21680

{{cs1 config|name-list-style=vanc}}

{{Chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 403602802

| ImageFile = CGS21680.png

| IUPACName = 3-[4-(2-{[6-Amino-9-(N-ethyl-β-D-ribofuranosyluronamide)-9H-purin-2-yl]amino}ethyl)phenyl]propanoic acid

| SystematicName = 3-{4-[2-({6-Amino-9-[(2R,3R,4S,5S)-5-(ethylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]-9H-purin-2-yl}amino)ethyl]phenyl}propanoic acid

| OtherNames = CGS 21680

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 120225-54-9

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = T5HB1E831H

| PubChem = 3086599

| IUPHAR_ligand2 = 424

| IUPHAR_ligand = 375

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 73283

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 331372

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 2343185

| SMILES = O=C(O)CCc1ccc(cc1)CCNc2nc(c3ncn(c3n2)[C@@H]4O[C@H](C(=O)NCC)[C@@H](O)[C@H]4O)N

| InChI = 1/C23H29N7O6/c1-2-25-21(35)18-16(33)17(34)22(36-18)30-11-27-15-19(24)28-23(29-20(15)30)26-10-9-13-5-3-12(4-6-13)7-8-14(31)32/h3-6,11,16-18,22,33-34H,2,7-10H2,1H3,(H,25,35)(H,31,32)(H3,24,26,28,29)/t16-,17+,18-,22+/m0/s1

| InChIKey = PAOANWZGLPPROA-RQXXJAGIBL

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C23H29N7O6/c1-2-25-21(35)18-16(33)17(34)22(36-18)30-11-27-15-19(24)28-23(29-20(15)30)26-10-9-13-5-3-12(4-6-13)7-8-14(31)32/h3-6,11,16-18,22,33-34H,2,7-10H2,1H3,(H,25,35)(H,31,32)(H3,24,26,28,29)/t16-,17+,18-,22+/m0/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = PAOANWZGLPPROA-RQXXJAGISA-N

}}

|Section2={{Chembox Properties

| Formula = C₂₃H₂₉N₇O₆

| MolarMass = 499.52

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

CGS-21680 is a specific adenosine A_2A subtype receptor agonist. It is usually presented as an organic hydrochloride salt with a molecular weight of 536.0 g/M. It is soluble up to 3.4 mg/mL in DMSO and 20 mg/mL in 45% (w/v) aq 2-hydroxypropyl-β-cyclodextrin.

The chemical is currently used by researchers interested in studying neuronal transmission with a high-affinity, subtype specific analogue for adenosine. This includes research in respiration where it is believed that A_2A receptors are involved in rhythm generation in the pre-Bötzinger complex. The drug is not currently approved for use in a therapeutic capacity.