CGS-9896

{{Short description|Anxiolytic drug used in scientific research}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 455086743

| IUPAC_name = 2-(4-chlorophenyl)-1H-pyrazolo[4,5-c]quinolin-3-one

| image = CGS-9896.svg

| width = 180

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 77779-36-3

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 86PWQ4PVN0

| ATC_prefix = none

| ATC_suffix =

| PubChem = 108030

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 97139

| ChEMBL = 507327

| C=16 | H=10 | Cl=1 | N=3 | O=1

| smiles = C1=CC=C2C(=C1)C3=C(C=N2)C(=O)N(N3)C4=CC=C(C=C4)Cl

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C16H10ClN3O/c17-10-5-7-11(8-6-10)20-16(21)13-9-18-14-4-2-1-3-12(14)15(13)19-20/h1-9,19H

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = QCBUAKLOWCOUCR-UHFFFAOYSA-N

}}

CGS-9896 is an anxiolytic drug used in scientific research. It has similar effects to benzodiazepine drugs but is structurally distinct and so is classed as a nonbenzodiazepine anxiolytic.{{cite journal |vauthors=Leidenheimer NJ, Schechter MD |title=Discriminative stimulus properties of CGS 9896: interactions within the GABA/benzodiazepine receptor complex |journal=Pharmacol Biochem Behav |volume=31 |issue=2 |pages=249–54 |date=Oct 1988 |pmid=2854261 |doi=10.1016/0091-3057(88)90342-5|s2cid=21773709 }}

CGS-9896 is a benzodiazepine receptor partial agonist which produces long-lasting anxiolytic and anticonvulsant effects in animal studies but does not produce sedative effects.{{cite journal |vauthors=Bernasconi R, Marescaux C, Vergnes M |title=Evaluation of the anticonvulsant and biochemical activity of CGS 8216 and CGS 9896 in animal models |journal=J Neural Transm |volume=71 |issue=1 |pages=11–27 |year=1988 |pmid=3343593 |doi=10.1007/BF01259406 |s2cid=31525533 |display-authors=etal}}{{cite journal |vauthors=Rump S, Raszewski W, Gidynska T, Galecka E |title=Effects of CGS 9896 in acute experimental intoxication with fluostigmine |journal=Arch. Toxicol. |volume=64 |issue=5 |pages=412–3 |year=1990 |pmid=2206111 |doi=10.1007/BF01973465 |bibcode=1990ArTox..64..412R |s2cid=19084019 }} It also increases appetite,{{cite journal |vauthors=Chen SW, Davies MF, Loew GH |title=Food palatability and hunger modulated effects of CGS 9896 and CGS 8216 on food intake |journal=Pharmacol Biochem Behav |volume=51 |issue=2–3 |pages=499–503 |year=1995 |pmid=7667375 |doi=10.1016/0091-3057(95)00020-W|s2cid=32809713 }} and reduces the development of gastrointestinal ulcers following chronic stress.{{cite journal |vauthors=Najim RA, Karim KH |title=Effect of CGS 9896 on stress-induced gastric ulcer in rat |journal=Clin Exp Pharmacol Physiol |volume=17 |issue=2 |pages=157–161 |date=Feb 1990 |pmid=2109664 |doi=10.1111/j.1440-1681.1990.tb01298.x |s2cid=37492286 }}