CHF-1024

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{Infobox drug

| drug_name =

| image = CHF-1024.svg

| width =

| caption =

| pronounce =

| tradename =

| Drugs.com =

| MedlinePlus =

| licence_CA =

| licence_EU =

| DailyMedID =

| licence_US =

| pregnancy_AU =

| pregnancy_category =

| dependency_liability =

| addiction_liability =

| routes_of_administration =

| class = Dopamine D₂ recpetor agonist; α₂-Adrenergic receptor agonist

| ATC_prefix = None

| ATC_suffix =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action =

| excretion =

| CAS_number = 39478-89-2

| CAS_supplemental =

| PubChem = 38005

| PubChemSubstance =

| IUPHAR_ligand =

| DrugBank =

| ChemSpiderID =

| UNII = 045Q4E2K14

| KEGG =

| ChEBI =

| ChEMBL =

| NIAID_ChemDB =

| PDB_ligand =

| synonyms = CHF1024; 5,6-Dihydroxy-2-methylaminotetralin

| IUPAC_name = 6-(methylamino)-5,6,7,8-tetrahydronaphthalene-1,2-diol

| C=11 | H=15 | N=1 | O=2

| SMILES = CNC1CCC2=C(C1)C=CC(=C2O)O

| StdInChI = 1S/C11H15NO2/c1-12-8-3-4-9-7(6-8)2-5-10(13)11(9)14/h2,5,8,12-14H,3-4,6H2,1H3

| StdInChIKey = BHDFPNRSDABMPW-UHFFFAOYSA-N

}}

CHF-1024, also known as 5,6-dihydroxy-2-methylaminotetralin, is a dopamine D₂ receptor agonist and α₂-adrenergic receptor agonist of the 2-aminotetralin family.{{cite journal | vauthors = Mealy NE, Leeson PA, Bayes M, Castaner J | title = Nolomirole Hydrochloride | journal = Drugs of the Future | volume = 26 | issue = 11 | pages = 1046 | date = 2001 | doi = 10.1358/dof.2001.026.11.642071 | url = http://access.portico.org/stable?au=pjbf78xdt6c | access-date = 19 June 2025 }}{{cite journal | vauthors = Tang WH, Francis GS | title = Novel pharmacological treatments for heart failure | journal = Expert Opinion on Investigational Drugs | volume = 12 | issue = 11 | pages = 1791–1801 | date = November 2003 | pmid = 14585055 | doi = 10.1517/13543784.12.11.1791 }} It is a cyclized phenethylamine analogue of the neurotransmitter dopamine. The drug is the active form of nolomirole (CHF-1035), a prodrug of CHF-1024 and the N,N-diisobutyryl diester of the compound. Nolomirole was investigated for the treatment of heart failure but was never marketed.