CIM-0216

{{Chembox

| ImageFile = CIM-0216_structure.png

| ImageSize = 200px

| ImageAlt =

| PIN = 2-(3,4-Dihydroquinolin-1(2H)-yl)-N-(5-methyl-1,2-oxazol-3-yl)-2-phenylacetamide

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 1031496-06-6

| PubChem = 42887770

| SMILES = CC1=CC(=NO1)NC(=O)C(C2=CC=CC=C2)N3CCCC4=CC=CC=C43

| ChemSpiderID = 21960401

| ChEMBL = 4303225

| StdInChI = 1S/C21H21N3O2/c1-15-14-19(23-26-15)22-21(25)20(17-9-3-2-4-10-17)24-13-7-11-16-8-5-6-12-18(16)24/h2-6,8-10,12,14,20H,7,11,13H2,1H3,(H,22,23,25)

| StdInChIKey = KSEXDSJYVSEVGF-UHFFFAOYSA-N }}

|Section2={{Chembox Properties

| C=21 | H=21 | N=3 | O=2

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| GHSPictograms = {{GHS07}}

| GHSSignalWord = Warning

| HPhrases = {{H-phrases|302|315|319|335}}

| PPhrases = {{P-phrases|261|264|270|271|280|301+312|302+352|304+340|305+351+338|312|321|330|332+313|337+313|362|403+233|405|501}}

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

CIM-0216 is a chemical compound which acts as a potent and selective activator of the TRPM3 calcium channel. It produces nociception and inflammation and is used to study the function of the TRPM3 receptor in these processes.{{cite journal | vauthors = Held K, Kichko T, De Clercq K, Klaassen H, Van Bree R, Vanherck JC, Marchand A, Reeh PW, Chaltin P, Voets T, Vriens J | display-authors = 6 | title = Activation of TRPM3 by a potent synthetic ligand reveals a role in peptide release | journal = Proceedings of the National Academy of Sciences of the United States of America | volume = 112 | issue = 11 | pages = E1363-72 | date = March 2015 | pmid = 25733887 | doi = 10.1073/pnas.1419845112 | doi-access = free | pmc = 4371942 | bibcode = 2015PNAS..112E1363H }}{{cite journal | vauthors = Thiel G, Rubil S, Lesch A, Guethlein LA, Rössler OG | title = Transient receptor potential TRPM3 channels: Pharmacology, signaling, and biological functions | journal = Pharmacological Research | volume = 124 | pages = 92–99 | date = October 2017 | pmid = 28720517 | doi = 10.1016/j.phrs.2017.07.014 }}{{cite journal | vauthors = Kelemen B, Lisztes E, Vladár A, Hanyicska M, Almássy J, Oláh A, Szöllősi AG, Pénzes Z, Posta J, Voets T, Bíró T, Tóth BI | display-authors = 6 | title = Volatile anaesthetics inhibit the thermosensitive nociceptor ion channel transient receptor potential melastatin 3 (TRPM3) | journal = Biochemical Pharmacology | volume = 174 | pages = 113826 | date = April 2020 | pmid = 31987857 | doi = 10.1016/j.bcp.2020.113826 | doi-access = free | hdl = 2437/278831 | hdl-access = free }}{{cite journal | vauthors = Vangeel L, Benoit M, Miron Y, Miller PE, De Clercq K, Chaltin P, Verfaillie C, Vriens J, Voets T | display-authors = 6 | title = Functional expression and pharmacological modulation of TRPM3 in human sensory neurons | journal = British Journal of Pharmacology | volume = 177 | issue = 12 | pages = 2683–2695 | date = June 2020 | pmid = 31985045 | doi = 10.1111/bph.14994 | pmc = 7236075 }}