CLD chromophore

{{chembox

| Name= CLD-1

| verifiedrevid = 421461034

| ImageFileL1 = CLD_2D.png

| ImageSizeL1 = 105px

| ImageFileR1 = CLD-chromophore-3D-sf.png

| ImageSizeR1 = 150px

| IUPACName =2-[4-[(E,3E)-3-[3-[(E)-2-[4-[bis[2-[tert-butyl(dimethyl)silyl]oxyethyl]amino]phenyl]ethenyl]-5,5-dimethylcyclohex-2-en-1-ylidene]prop-1-enyl]-3-cyano-5,5-dimethylfuran-2-ylidene]propanedinitrile

| OtherNames = CLD-1

| Section1 = {{Chembox Identifiers

| index1_label = CLD-1

| CASNo1 = 368874-13-9

| ChemSpiderID1 = 62367708

| PubChem1 = 89148469

| InChI1=1S/C45H64N4O3Si2/c1-42(2,3)53(11,12)50-26-24-49(25-27-51-54(13,14)43(4,5)6)38-22-20-34(21-23-38)18-19-36-28-35(29-44(7,8)30-36)16-15-17-40-39(33-48)41(37(31-46)32-47)52-45(40,9)10/h15-23,28H,24-27,29-30H2,1-14H3/b17-15+,19-18+,35-16-

| InChIKey1 = PYNHPJZBYGNOPU-ONTZPWRJSA-N

| SMILES1 = CC1(CC(=C/C(=C/C=C/C2=C(C(=C(C#N)C#N)OC2(C)C)C#N)/C1)/C=C/C3=CC=C(C=C3)N(CCO[Si](C)(C)C(C)(C)C)CCO[Si](C)(C)C(C)(C)C)C

}}

| Section2 = {{Chembox Properties

| Formula = C₃₁H₃₂N₄O

| MolarMass = 476.61

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

CLD-1 is a vibrant blue dye originally synthesized for application in nonlinear electro-optics.{{cite journal

| author = CHENG ZHANG and Larry R. Dalton

| title = Low V^π Electrooptic Modulators from CLD-1: Chromophore Design and Synthesis, Material Processing, and Characterization

| journal = Chem. Mater.

| volume = 13

| issue = 9

| year = 2001

| doi = 10.1021/cm010463j

| pages = 3043–3050}}