CMV423

{{Short description|Chemical compound}}

{{Orphan|date=July 2016}}

{{Infobox drug

| drug_name =

| INN =

| type =

| image = CMV423.svg

| width = 150px

| pronounce =

| tradename =

| Drugs.com =

| MedlinePlus =

| pregnancy_AU =

| pregnancy_AU_comment =

| pregnancy_category=

| routes_of_administration =

| ATCvet =

| ATC_prefix =

| ATC_suffix =

| legal_AU =

| legal_AU_comment =

| legal_BR =

| legal_BR_comment =

| legal_CA =

| legal_CA_comment =

| legal_DE =

| legal_DE_comment =

| legal_NZ =

| legal_NZ_comment =

| legal_UK =

| legal_UK_comment =

| legal_US =

| legal_US_comment =

| legal_EU =

| legal_EU_comment =

| legal_UN =

| legal_UN_comment =

| legal_status = Investigational

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action=

| excretion =

| CAS_number = 186829-19-6

| CAS_number_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = PDX37M872C

| PubChem = 489128

| DrugBank =

| ChemSpiderID = 428515

| synonyms = CMV-423; RPR-111423

| IUPAC_name = 2-Chloro-3-(pyridin-3-yl)-5,6,7,8-tetrahydroindolizine-1-carboxamide

| C=14 | H=14 | Cl=1 | N=3 | O=1

| StdInChI = 1S/C14H14ClN3O/c15-12-11(14(16)19)10-5-1-2-7-18(10)13(12)9-4-3-6-17-8-9/h3-4,6,8H,1-2,5,7H2,(H2,16,19)

| StdInChIKey = KNGXENHWYNLKBU-UHFFFAOYSA-N

| smiles = c1cc(cnc1)c2c(c(c3n2CCCC3)C(=O)N)Cl

}}

CMV423 (2-chloro-3-pyridin-3-yl-5,6,7,8-tetrahydroindolizine-1-carboxamide) is an experimental antiviral drug that has been studied for the treatment of cytomegalovirus (CMV) infection{{cite journal | vauthors = Snoeck R, Andrei G, Bodaghi B, Lagneaux L, Daelemans D, de Clercq E, Neyts J, Schols D, Naesens L, Michelson S, Bron D, Otto MJ, Bousseau A, Nemecek C, Roy C | display-authors = 6 | title = 2-Chloro-3-pyridin-3-yl-5,6,7,8-tetrahydroindolizine-1-carboxamide (CMV423), a new lead compound for the treatment of human cytomegalovirus infections | journal = Antiviral Research | volume = 55 | issue = 3 | pages = 413–424 | date = September 2002 | pmid = 12206879 | doi = 10.1016/s0166-3542(02)00074-8 }} and human herpesvirus 6 (HHV-6) infection.{{cite web | url = https://adisinsight.springer.com/drugs/800010856 | title = CMV 423 | work = AdisInsight | publisher = Springer Nature Switzerland AG }}{{cite book | vauthors = Aoki FY | chapter = 45 - Antivirals against Herpes Viruses | pages = 546–562 | veditors = Bennett JE, Blaser MJ, Dolin R | title = Mandell, Douglas, and Bennett's Principles and Practice of Infectious Diseases | edition = 8th | date = 2015 | doi = 10.1016/B978-1-4557-4801-3.00045-X | isbn = 978-1-4557-4801-3 }} The drug was investigated by Sanofi-Aventis, but its development was discontinued by 2018 before entering clinical trials.