CP-93129
{{Short description|Chemical compound}}
{{Drugbox
| IUPAC_name = 3-(1,2,3,6-tetrahydropyridin-4-yl)-1,4-dihydropyrrolo[3,2-b]pyridin-5-one
| image = CP-93129 Structure.svg
| width = 220
| tradename =
| legal_status =
| routes_of_administration =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number = 127792-75-0
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = Y4BW369LGS
| IUPHAR_ligand = 11
| PubChem = 124007
| ChemSpiderID = 110524
| C=12 | H=13 | N=3 | O=1
| smiles = C3CNCC=C3c(c1n2)cnc1ccc2=O
}}
CP-93129 is a drug which acts as a potent and selective serotonin 5-HT1B receptor agonist, with approximately 150x and 200x selectivity over the closely related 5-HT1D and 5-HT1A receptors.{{cite journal | vauthors = Macor JE, Burkhart CA, Heym JH, Ives JL, Lebel LA, Newman ME, Nielsen JA, Ryan K, Schulz DW, Torgersen LK | display-authors = 6 | title = 3-(1,2,5,6-Tetrahydropyrid-4-yl)pyrrolo[3,2-b]pyrid-5-one: a potent and selective serotonin (5-HT1B) agonist and rotationally restricted phenolic analogue of 5-methoxy-3-(1,2,5,6-tetrahydropyrid-4-yl)indole | journal = Journal of Medicinal Chemistry | volume = 33 | issue = 8 | pages = 2087–93 | date = August 1990 | pmid = 2374139 | doi = 10.1021/jm00170a007 }} It is used in the study of 5-HT1B receptors in the brain, particularly their role in modulating the release of other neurotransmitters.{{cite journal | vauthors = De Groote L, Olivier B, Westenberg HG | title = Role of 5-HT1B receptors in the regulation of extracellular serotonin and dopamine in the dorsal striatum of mice | journal = European Journal of Pharmacology | volume = 476 | issue = 1–2 | pages = 71–7 | date = August 2003 | pmid = 12969751 | doi = 10.1016/s0014-2999(03)02154-x }}{{cite journal | vauthors = Przegaliński E, Papla I, Siwanowicz J, Filip M | title = Effects of 5-HT1B receptor ligands microinjected into the ventral tegmental area on the locomotor and sensitizating effects of cocaine in rats | journal = European Neuropsychopharmacology | volume = 14 | issue = 3 | pages = 217–25 | date = May 2004 | pmid = 15056481 | doi = 10.1016/S0924-977X(03)00106-8 | s2cid = 308992 }}{{cite journal | vauthors = Bramley JR, Sollars PJ, Pickard GE, Dudek FE | title = 5-HT1B receptor-mediated presynaptic inhibition of GABA release in the suprachiasmatic nucleus | journal = Journal of Neurophysiology | volume = 93 | issue = 6 | pages = 3157–64 | date = June 2005 | pmid = 15716370 | doi = 10.1152/jn.00770.2004 | url = https://digitalcommons.unl.edu/cgi/viewcontent.cgi?article=1252&context=vetscipapers | citeseerx = 10.1.1.325.6052 }}{{cite journal | vauthors = Saitow F, Murano M, Suzuki H | title = Modulatory effects of serotonin on GABAergic synaptic transmission and membrane properties in the deep cerebellar nuclei | journal = Journal of Neurophysiology | volume = 101 | issue = 3 | pages = 1361–74 | date = March 2009 | pmid = 19144744 | doi = 10.1152/jn.90750.2008 }}
References
{{Reflist|2}}
{{Serotonergics}}
Category:Serotonin receptor agonists
Category:Drugs developed by Pfizer
{{nervous-system-drug-stub}}