CP-94253

{{Short description|Potent and selective serotonin 5-HT1B receptor agonist}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 449557319

| IUPAC_name = 3-(1,2,5,6-tetrahydro-4-pyridyl)-5-propoxypyrrolo[3,2-b]pyridine

| image = CP-94253 Structure.svg

| width = 220

| tradename =

| legal_status =

| routes_of_administration =

| metabolism =

| elimination_half-life =

| excretion =

| IUPHAR_ligand = 3221

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 131084-35-0

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = FYC6YY5RYL

| PubChem = 4029677

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 3246572

| C=15 | H=19 | N=3 | O=1

| smiles = c13nc(OCCC)ccc1[nH]cc3C2=CCNCC2

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C15H19N3O/c1-2-9-19-14-4-3-13-15(18-14)12(10-17-13)11-5-7-16-8-6-11/h3-5,10,16-17H,2,6-9H2,1H3

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = KWQWBZIGHIOKIO-UHFFFAOYSA-N

}}

CP-94253 is a drug which acts as a potent and selective serotonin 5-HT1B receptor agonist, with approximately 25× and 40× selectivity over the closely related 5-HT1D and 5-HT1A receptors.{{cite journal | vauthors = Koe KB, Nielsen JA, Macor JE, Heym J | year = 1992 | title = Biochemical and behavioral studies of the 5-HT1B receptor agonist, CP-94,253 | journal = Drug Development Research | volume = 26 | issue = 3| pages = 241–250 | doi = 10.1002/ddr.430260305 | s2cid = 85358992 }} It has a range of behavioral effects, based on animal testing. The effects include the following: promoting wakefulness by increasing dopamine release in the brain;{{cite journal | vauthors = Monti JM, Monti D, Jantos H, Ponzoni A | title = Effects of selective activation of the 5-HT1B receptor with CP-94,253 on sleep and wakefulness in the rat | journal = Neuropharmacology | volume = 34 | issue = 12 | pages = 1647–1651 | date = December 1995 | pmid = 8788962 | doi = 10.1016/0028-3908(95)00112-3 | s2cid = 11872727 }}{{cite journal | vauthors = Iyer RN, Bradberry CW | title = Serotonin-mediated increase in prefrontal cortex dopamine release: pharmacological characterization | journal = The Journal of Pharmacology and Experimental Therapeutics | volume = 277 | issue = 1 | pages = 40–47 | date = April 1996 | doi = 10.1016/S0022-3565(25)12836-X | pmid = 8613947 }} reducing food intake and promoting satiety;{{cite journal | vauthors = Halford JC, Blundell JE | title = The 5-HT1B receptor agonist CP-94,253 reduces food intake and preserves the behavioural satiety sequence | journal = Physiology & Behavior | volume = 60 | issue = 3 | pages = 933–939 | date = September 1996 | pmid = 8873272 | doi = 10.1016/0031-9384(96)00073-x | s2cid = 24349948 }}{{cite journal | vauthors = Lee MD, Simansky KJ | title = CP-94, 253: a selective serotonin1B (5-HT1B) agonist that promotes satiety | journal = Psychopharmacology | volume = 131 | issue = 3 | pages = 264–270 | date = June 1997 | pmid = 9203237 | doi = 10.1007/s002130050292 | s2cid = 33969765 }}{{cite journal | vauthors = Lee MD, Kennett GA, Dourish CT, Clifton PG | title = 5-HT1B receptors modulate components of satiety in the rat: behavioural and pharmacological analyses of the selective serotonin1B agonist CP-94,253 | journal = Psychopharmacology | volume = 164 | issue = 1 | pages = 49–60 | date = October 2002 | pmid = 12373419 | doi = 10.1007/s00213-002-1162-7 | s2cid = 2926575 }} enhancing the reinforcing effects of cocaine;{{cite journal | vauthors = Parsons LH, Weiss F, Koob GF | title = Serotonin1B receptor stimulation enhances cocaine reinforcement | journal = The Journal of Neuroscience | volume = 18 | issue = 23 | pages = 10078–10089 | date = December 1998 | pmid = 9822762 | pmc = 6793270 | doi = 10.1523/JNEUROSCI.18-23-10078.1998 }}{{cite journal | vauthors = Przegalinski E, Filip M, Papla I, Siwanowicz J | title = Effect of serotonin (5-HT)1B receptor ligands on cocaine sensitization in rats | journal = Behavioural Pharmacology | volume = 12 | issue = 2 | pages = 109–116 | date = April 2001 | pmid = 11396515 | doi = 10.1097/00008877-200104000-00004 }}{{cite journal | vauthors = Przegaliński E, Gołda A, Frankowska M, Zaniewska M, Filip M | title = Effects of serotonin 5-HT1B receptor ligands on the cocaine- and food-maintained self-administration in rats | journal = European Journal of Pharmacology | volume = 559 | issue = 2–3 | pages = 165–172 | date = March 2007 | pmid = 17291490 | doi = 10.1016/j.ejphar.2006.12.012 }}{{cite journal | vauthors = Przegaliński E, Gołda A, Filip M | title = Effects of serotonin (5-HT)(1B) receptor ligands on cocaine-seeking behavior in rats | journal = Pharmacological Reports | volume = 60 | issue = 6 | pages = 798–810 | year = 2008 | pmid = 19211971 }} and possible antidepressant effects.{{cite journal | vauthors = Tatarczyńska E, Antkiewicz-Michaluk L, Kłodzińska A, Stachowicz K, Chojnacka-Wójcik E | title = Antidepressant-like effect of the selective 5-HT1B receptor agonist CP 94253: a possible mechanism of action | journal = European Journal of Pharmacology | volume = 516 | issue = 1 | pages = 46–50 | date = May 2005 | pmid = 15913599 | doi = 10.1016/j.ejphar.2005.04.025 }} A recent study{{cite journal | vauthors = Scott SN, Garcia R, Powell GL, Doyle SM, Ruscitti B, Le T, Esquer A, Blattner KM, Blass BE, Neisewander JL | display-authors = 6 | title = 5-HT1B receptor agonist attenuates cocaine self-administration after protracted abstinence and relapse in rats | journal = Journal of Psychopharmacology | volume = 35 | issue = 10 | pages = 1216–1225 | date = October 2021 | pmid = 34049460 | doi = 10.1177/02698811211019279 | s2cid = 235243643 }} found that "Regardless of sex, CP94253 decreased cocaine intake after abstinence and during resumption of SA [self-administration] and decreased cue reactivity" suggesting that agonism of the inhibitory 5-HT2B receptors may diminish the cognitive reward of cocaine usage and increased use of the drug without a period of abstinence may be a product of test subjects trying to achieve a previously rewarding experience through larger dosages of cocaine.

References