CPD-1

{{Short description|Drug}}

{{Drugbox

| IUPAC_name = (3S)-3-Methyl-1-[4-(trifluoromethyl)-1-benzofuran-7-yl]piperazine

| image = CPD-1 Structure.svg

| width = 175px

| tradename =

| pregnancy_category =

| legal_status = Uncontrolled

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 325145-37-7

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = ZZ7JB9QBU3

| ATC_prefix =

| ATC_suffix =

| PubChem = 9925822

| ChEMBL = 2260570

| ChemSpiderID = 8101457

| C=14 | H=15 | F=3 | N=2 | O=1

| smiles = C[C@H]1CN(CCN1)C2=C3C(=C(C=C2)C(F)(F)F)C=CO3

| StdInChI = 1S/C14H15F3N2O/c1-9-8-19(6-5-18-9)12-3-2-11(14(15,16)17)10-4-7-20-13(10)12/h2-4,7,9,18H,5-6,8H2,1H3/t9-/m0/s1

| StdInChIKey = RZSIBGYUCGYDKG-VIFPVBQESA-N

}}

CPD-1 (LS-193743) is a drug with a benzofuranyl piperazine structure, which acts as a potent and selective agonist for the 5-HT₂ receptor family, with highest affinity and full agonist efficacy at the 5-HT_2C subtype, and lower affinity and partial agonist action at the 5-HT_2A and 5-HT_2B subtypes.{{cite journal | vauthors = Ahmed A, Choo H, Cho YS, Park WK, Pae AN | title = Identification of novel serotonin 2C receptor ligands by sequential virtual screening | journal = Bioorganic & Medicinal Chemistry | volume = 17 | issue = 13 | pages = 4559–68 | date = July 2009 | pmid = 19464901 | doi = 10.1016/j.bmc.2009.05.003 }}{{cite journal | vauthors = Rodriguez MM, Overshiner C, Leander JD, Li X, Morrow D, Conway RG, Nelson DL, Briner K, Witkin JM | display-authors = 6 | title = Behavioral Effects of a Novel Benzofuranyl-Piperazine Serotonin-2C Receptor Agonist Suggest a Potential Therapeutic Application in the Treatment of Obsessive-Compulsive Disorder | journal = Frontiers in Psychiatry | volume = 8 | pages = 89 | date = 2017 | pmid = 28588509 | pmc = 5438973 | doi = 10.3389/fpsyt.2017.00089 | doi-access = free }}