CTW0415

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{Drugbox

| IUPAC_name = (2S,4R)-N-[(2S)-2,3-dihydroxypropyl]-4-phenylpiperidine-2-carboxamide

| image = CTW0415.svg

| width =

| tradename =

| pregnancy_category =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 2772105-16-3

| ATC_prefix =

| ATC_suffix =

| ChEMBL = 4633717

| PubChem = 156010013

| ChemSpiderID = 123962189

| C=15 | H=22 | N=2 | O=3

| smiles = C1CN[C@@H](C[C@@H]1C2=CC=CC=C2)C(=O)NC[C@@H](CO)O

| StdInChI = 1S/C15H22N2O3/c18-10-13(19)9-17-15(20)14-8-12(6-7-16-14)11-4-2-1-3-5-11/h1-5,12-14,16,18-19H,6-10H2,(H,17,20)/t12-,13+,14+/m1/s1

| StdInChIKey = OQMSTMCQUFBTSL-RDBSUJKOSA-N

}}

CTW0415 is an experimental drug from the piperidine family, which acts as a selective positive allosteric modulator of the 5-HT2C receptor, with higher potency than older drugs such as VA012. Structure-activity relationship studies showed that small variations to chain length and side chain substitution could lead to preferential binding for either 5-HT2C or the related 5-HT2A receptor, which subsequently led to the discovery of the related 5-HT2A selective positive allosteric modulator CTW0404.{{cite journal | vauthors = Wold EA, Garcia EJ, Wild CT, Miszkiel JM, Soto CA, Chen J, Pazdrak K, Fox RG, Anastasio NC, Cunningham KA, Zhou J | title = Discovery of 4-Phenylpiperidine-2-Carboxamide Analogues as Serotonin 5-HT2C Receptor-Positive Allosteric Modulators with Enhanced Drug-like Properties | journal = Journal of Medicinal Chemistry | volume = 63 | issue = 14 | pages = 7529–7544 | date = July 2020 | pmid = 32567857 | pmc = 8434884 | doi = 10.1021/acs.jmedchem.9b01953 }}{{cite journal | vauthors = Zamora JC, Merritt CR, Bolinger AA, Fox RG, Wild CT, Wold EA, Garcia EJ, Pazdrak K, Mifflin RC, Stafford SJ, Anastasio NC | title = Serendipitous Discovery of Novel 5-HT2AR Positive Allosteric Modulators (PAMs) Derived From 5-HT2CR PAM Scaffolds | journal = The Journal of Pharmacology and Experimental Therapeutics | volume = 389 | pages = 87 | date = 2024 | doi = 10.1124/jpet.087.985400 }}{{cite patent | title = Novel heterocyclic compounds as serotonin (5-ht) 5-ht2a and 5-ht2c receptor positive allosteric modulators. | number = 2023/023287 | url = https://patents.google.com/patent/WO2023023287A1/en | inventor = Zhou J, Cunningham KA, Bolinger AA, Anastasio NC | country = WO | assign = The Board of Regents of the University of Texas System | pubdate = 22 February 2024 }}

References