CU-CPT4a

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = (2R)-2-[(3-chloro-6-fluoro-1-benzothiophene-2-carbonyl)amino]-3-phenylpropanoic acid

| image = CU-CPT4a Structure.svg

| tradename =

| legal_US =

| legal_status =

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 1279713-77-7

| PubChem = 53242268

| ChemSpiderID = 30774264

| ChEMBL = 4303728

| C=18 | H=13 | Cl=1 | F=1 | N=1 | O=3 | S=1

| SMILES = C1=CC=C(C=C1)C[C@H](C(=O)O)NC(=O)C2=C(C3=C(S2)C=C(C=C3)F)Cl

| StdInChI=1S/C18H13ClFNO3S/c19-15-12-7-6-11(20)9-14(12)25-16(15)17(22)21-13(18(23)24)8-10-4-2-1-3-5-10/h1-7,9,13H,8H2,(H,21,22)(H,23,24)/t13-/m1/s1

| StdInChIKey = IAASQMCXDRISAV-CYBMUJFWSA-N

}}{{Context|date=March 2021}}

CU-CPT4a is a drug which acts as a selective antagonist of Toll-like receptor 3 (TLR3), with an IC50 of 3.44 μM. It is used for research into the function of TRL3 and its role in inflammation, autoimmune disorders and cancer.{{cite journal | vauthors = Martin-Gayo E, Cole MB, Kolb KE, Ouyang Z, Cronin J, Kazer SW, Ordovas-Montanes J, Lichterfeld M, Walker BD, Yosef N, Shalek AK, Yu XG | display-authors = 6 | title = A Reproducibility-Based Computational Framework Identifies an Inducible, Enhanced Antiviral State in Dendritic Cells from HIV-1 Elite Controllers | journal = Genome Biology | volume = 19 | issue = 1 | pages = 10 | date = January 2018 | pmid = 29378643 | doi = 10.1186/s13059-017-1385-x | pmc = 5789701 | doi-access = free }}{{cite journal | vauthors = Lomphithak T, Choksi S, Mutirangura A, Tohtong R, Tencomnao T, Usubuchi H, Unno M, Sasano H, Jitkaew S | title = Receptor-interacting protein kinase 1 is a key mediator in TLR3 ligand and Smac mimetic-induced cell death and suppresses TLR3 ligand-promoted invasion in cholangiocarcinoma | journal = Cell Communication and Signaling | volume = 18 | issue = 1 | pages = 161 | date = October 2020 | pmid = 33036630 | pmc = 7545934 | doi = 10.1186/s12964-020-00661-3 | doi-access = free }}

See also

References