CUMYL-CBMICA

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = 1-(cyclobutylmethyl)-N-(2-phenylpropan-2-yl)indole-3-carboxamide

| image = CUMYL-CBMICA_structure.png

| image_class = skin-invert-image

| width = 200px

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_DE = NpSG

| legal_UK = Class B

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 2571070-88-5

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = GPD3YVJ5RT

| ATC_prefix =

| ATC_suffix =

| PubChem = 155884426

| ChemSpiderID = 84400460

| smiles = CC(C)(NC(=O)c3cn(CC1CCC1)c2ccccc23)c4ccccc4

| C=23 | H=26 | N=2 | O=1

| StdInChI=1S/C23H26N2O/c1-23(2,18-11-4-3-5-12-18)24-22(26)20-16-25(15-17-9-8-10-17)21-14-7-6-13-19(20)21/h3-7,11-14,16-17H,8-10,15H2,1-2H3,(H,24,26)

| StdInChIKey = INXXQNIOWMOYEJ-UHFFFAOYSA-N

}}

CUMYL-CBMICA (SGT-280) is an indole-3-carboxamide based synthetic cannabinoid receptor agonist which has been sold as a designer drug,{{cite journal | vauthors = Halter S, Pulver B, Wilde M, Haschimi B, Westphal F, Riedel J, Pütz M, Schönberger T, Stoll S, Schäper J, Auwärter V | display-authors = 6 | title = Cumyl-CBMICA: A new synthetic cannabinoid receptor agonist containing a cyclobutyl methyl side chain | journal = Drug Testing and Analysis | date = October 2020 | volume = 13 | issue = 1 | pages = 208–216 | pmid = 33037749 | doi = 10.1002/dta.2942 | doi-access = free }}{{cite journal | vauthors = Polettini AE, Kutzler J, Sauer C, Bleicher S, Schultis W | title = LC-QToFMS Presumptive Identification of Synthetic Cannabinoids without Reference Chromatographic Retention/Mass Spectral Information. I. Reversed-Phase Retention Time QSPR Prediction as an Aid to Identification of New/Unknown Compounds | journal = Journal of Analytical Toxicology | date = September 2020 | volume = 45 | issue = 5 | pages = 429–439 | pmid = 32896861 | doi = 10.1093/jat/bkaa126|issn=0146-4760 }} first being identified in Germany in August 2019. Since the structure fell outside the German drug analogue law provisions at the time, an amendment was made to the law to expand the relevant definition, which came into effect in April 2020.{{cite web | url = https://ec.europa.eu/growth/tools-databases/tris/en/index.cfm/search/?trisaction=search.detail&year=2020&num=173&fLang=EN&dNum=1 | title = Draft Ordinance amending the Annex to the New Psychoactive Substances Act. Notification Number: 2020/173/D | location = Germany | date = 30 March 2020 }} It has been shown to act as a CB₁ receptor agonist with an EC₅₀ of 62.9nM.{{cite journal | vauthors = Cannaert A, Sparkes E, Pike E, Luo JL, Fang A, Kevin RC, Ellison R, Gerona R, Banister SD, Stove CP | display-authors = 6 | title = in Vitro Cannabinoid Receptor 1 Activity of Recently Detected Synthetic Cannabinoids 4F-MDMB-BICA, 5F-MPP-PICA, MMB-4en-PICA, CUMYL-CBMICA, ADB-BINACA, APP-BINACA, 4F-MDMB-BINACA, MDMB-4en-PINACA, A-CHMINACA, 5F-AB-P7AICA, 5F-MDMB-P7AICA, and 5F-AP7AICA | journal = ACS Chemical Neuroscience | date = November 2020 | volume = 11 | issue = 24 | pages = 4434–4446 | pmid = 33253529 | doi = 10.1021/acschemneuro.0c00644 | s2cid = 227246346 }}