CX157

{{short description|Chemical compound}}

{{Drugbox

| verifiedrevid = 396516252

| IUPAC_name = 3-fluoro-7-(2,2,2-trifluoroethoxy)phenoxathiine 10,10-dioxide

| image = CX157 structure.svg

| tradename =

| pregnancy_category =

| legal_status = Uncontrolled

| routes_of_administration = Oral

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 205187-53-7

| CAS_number_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = O6L62LZJ0Q

| ATC_prefix = none

| ATC_suffix =

| PubChem = 18687754

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 13701383

| C = 14 | H = 8 | F = 4 | O = 4 | S = 1

| smiles = FC(F)(F)COc2cc3Oc1cc(F)ccc1S(=O)(=O)c3cc2

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C14H8F4O4S/c15-8-1-3-12-10(5-8)22-11-6-9(21-7-14(16,17)18)2-4-13(11)23(12,19)20/h1-6H,7H2

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = PDIMOTRDGUQMNY-UHFFFAOYSA-N

}}

CX157 (proposed trade name TriRima, formerly Tyrima) is a selective and reversible inhibitor of MAO-A (RIMA).{{cite conference |vauthors=Fielding R, Mielach F, Free J, Pande A |title=Pharmacokinetics and oral bioavailability of CX157, a reversible selective MAO-A inhibitor, in primates |year=2007 |conference=2007 AAPS Annual Meeting & Exposition |url=http://www.aapsj.org/abstracts/AM_2007/AAPS2007-001233.PDF |accessdate=2009-06-14 |archive-url=https://web.archive.org/web/20110526192425/http://www.aapsj.org/abstracts/AM_2007/AAPS2007-001233.PDF |archive-date=2011-05-26 |url-status=dead }} As of 2007 it was in phase II clinical trials for the treatment of depression.{{ClinicalTrialsGov|NCT00739908}|A Study of CX157 (TriRima) for the Treatment of Depression (CX157-200)}} In 2013, work on the drug was terminated.[http://adisinsight.springer.com/drugs/800025697]