Calcium hexamine thiocyanate

{{Short description|Combination drug}}

{{Drugbox

| verifiedrevid = 428753447

| IUPAC_name =

| image =

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 859974-17-7

| CAS_number_Ref = {{Cascite|changed|GSRS}}

| ATC_prefix = R01

| ATC_suffix = AX01

| PubChem = 122197551

| ChemSpiderID = 58955964

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChEMBL = 3707448

| UNII = RPJ55R4EFX

| chemical_formula =

| StdInChI=1S/C6H12N4.2CHNS.Ca/c1-7-2-9-4-8(1)5-10(3-7)6-9;2*2-1-3;/h1-6H2;2*3H;/q;;;+2/p-2

| StdInChIKey = MYCYALXPHWPBMJ-UHFFFAOYSA-L

| SMILES = C1N2CN3CN1CN(C2)C3.C(#N)[S-].C(#N)[S-].[Ca+2]

| molecular_weight =

}}

Calcium hexamine thiocyanate is a pharmaceutical drug that has been used in nasal preparations. It contains hexamine (hexamethylenetetramine) and thiocyanate. This combination has also been used for the treatment of urinary tract infections.{{cite journal | vauthors = Grundmann I | title = [Combined hexamine-rhodane therapy of diseases of the urinary tract] | journal = Medizinische Monatsschrift | volume = 5 | issue = 6 | pages = 416–9 | date = June 1951 | pmid = 14862887 }}