Calcium lactate gluconate

{{Chembox

| Watchedfields = changed

| verifiedrevid = 435224166

| Name =

| ImageFile = Calcium lactate gluconate.svg

| ImageClass = skin-invert-image

| ImageFile1 = Calcium-lactate-gluconate-3D-balls.png

| ImageSize = 250px

| ImageSize1 = 250px

| IUPACName = calcium; (R/S)-2-hydroxypropanoate; (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate

| OtherNames =

| SystematicName =

| Section1 = {{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 83274

| InChI = 1/C6H12O7.C3H6O3.Ca/c7-1-2(8)3(9)4(10)5(11)6(12)13;1-2(4)3(5)6;/h2-5,7-11H,1H2,(H,12,13);2,4H,1H3,(H,5,6);/q;;+2/p-2/t2-,3-,4+,5-;;/m1../s1

| InChIKey = PWKNEBQRTUXXLT-DAEZFGRIBL

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C6H12O7.C3H6O3.Ca/c7-1-2(8)3(9)4(10)5(11)6(12)13;1-2(4)3(5)6;/h2-5,7-11H,1H2,(H,12,13);2,4H,1H3,(H,5,6);/q;;+2/p-2/t2-,3-,4+,5-;;/m1../s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = PWKNEBQRTUXXLT-ZBHRUSISSA-L

| CASNo_Ref = {{cascite|correct|??}}

| CASNo=11116-97-5

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 472LWJ3Y9N

| PubChem=92237

| SMILES = [Ca+2].[O-]C(=O)C(O)C.[O-]C(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO

}}

| Section2 = {{Chembox Properties

| C=9 | H=16 | Ca=1 | O=10

| Appearance=white, taste- and odourless, crystalline solid

| Density=

| MeltingPt=

| BoilingPt=

| Solubility=400 g/L

}}

| Section3 =

| Section4 =

| Section5 =

| Section6 = {{Chembox Pharmacology

| ATCCode_prefix = A12

| ATCCode_suffix = AA06

}}

| Section7 = {{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

}}

}}

Calcium lactate gluconate, also known as GLOCAL, is a soluble salt of calcium, lactic acid and gluconic acid used in effervescent calcium tablets.{{cite book|title=Austria-Codex|editor=Haberfeld, H|publisher=Österreichischer Apothekerverlag|location=Vienna|year=2009|edition=2009/2010|isbn=978-3-85200-196-8|language=German}} Its chemical formula is Ca₅(C₃H₅O₃)₆·(C₆H₁₁O₇)₄·2H₂O. It was first developed by Sandoz, Switzerland. Calcium lactate gluconate is used in the functional and fortified food industry due to its good solubility and neutral taste.{{cite journal |author=Gerhard Gerstner |title=Calcium Lactate Gluconate – the innovative solution for extra calcium |journal=Innovations in Food Technology |volume=3 |year=2002 |pages=2–3 |url=http://www.jungbunzlauer.com/media/uploads/pdf/Special_Salts/Calcium_Lactate_Gluconate_Aug02.pdf |access-date=2012-01-08 |archive-url=https://web.archive.org/web/20120111121130/http://www.jungbunzlauer.com/media/uploads/pdf/Special_Salts/Calcium_Lactate_Gluconate_Aug02.pdf |archive-date=2012-01-11 |url-status=dead }} In addition, it is used in various spherification techniques in molecular gastronomy. It can also be used to help neutralize HF (hydrofluoric acid) poisoning.{{fact|date=January 2012}}