Calcium malate

{{chembox

| verifiedrevid = 431562303

| ImageFile=Calcium malate.png

| ImageSize=200px

| IUPACName=Calcium 2-hydroxybutanedioate

| OtherNames=

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 146673

| InChI = 1/C4H6O5.Ca/c5-2(4(8)9)1-3(6)7;/h2,5H,1H2,(H,6,7)(H,8,9);/q;+2/p-2

| InChIKey = OLOZVPHKXALCRI-NUQVWONBAL

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C4H6O5.Ca/c5-2(4(8)9)1-3(6)7;/h2,5H,1H2,(H,6,7)(H,8,9);/q;+2/p-2

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = OLOZVPHKXALCRI-UHFFFAOYSA-L

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo=16426-50-9

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = D48OP746DW

| PubChem=167659

| SMILES = [Ca+2].[O-]C(=O)CC(O)C([O-])=O

}}

|Section2={{Chembox Properties

| Formula=C₄H₄CaO₅

| MolarMass=172.15 g/mol

| Appearance=

| Density=

| MeltingPt=

| BoilingPt=

| Solubility=slightly soluble[https://eur-lex.europa.eu/LexUriServ/LexUriServ.do?uri=OJ:L:2000:277:0001:0061:EN:PDF Commission directive 2000/63/EC of 5 October 2000] Official Journal of the European Communities

}}

|Section3={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

}}

}}

Calcium malate is a compound with formula Ca(C₂H₄O(COO)₂). It is the calcium salt of malic acid. As a food additive, it has the E number E352.

It is related to, but different from, calcium citrate malate.{{cite journal|title=Calcium revisited: part II calcium supplements and their effects|journal=BoneKEy Reports|volume=3|pages=579|doi=10.1038/bonekey.2014.74|pmid=25328675|pmc=4189255|year=2014|last1=Lamy|first1=Olivier|last2=Burckhardt|first2=Peter}}