Calphostin C

{{Chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 405921416

| ImageFile = Calphostin C.png

| ImageSize = 200px

| IUPACName = [(2R)-1-[3,10-dihydroxy-12-[(2R)-2-(4-hydroxyphenoxy)carbonyloxypropyl]-2,6,7,11-tetramethoxy-4,9-dioxoperylen-1-yl]propan-2-yl] benzoate

| OtherNames =

|Section1={{Chembox Identifiers

| IUPHAR_ligand = 5156

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 121263-19-2

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = I271P23G24

| PubChem = 10930781

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1256495

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 9106020

| InChI = 1/C44H38O14/c1-20(56-43(50)22-10-8-7-9-11-22)16-25-31-32-26(17-21(2)57-44(51)58-24-14-12-23(45)13-15-24)42(55-6)40(49)34-28(47)19-30(53-4)36(38(32)34)35-29(52-3)18-27(46)33(37(31)35)39(48)41(25)54-5/h7-15,18-21,45,48-49H,16-17H2,1-6H3/t20-,21-/m1/s1

| InChIKey = LSUTUUOITDQYNO-NHCUHLMSBH

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C44H38O14/c1-20(56-43(50)22-10-8-7-9-11-22)16-25-31-32-26(17-21(2)57-44(51)58-24-14-12-23(45)13-15-24)42(55-6)40(49)34-28(47)19-30(53-4)36(38(32)34)35-29(52-3)18-27(46)33(37(31)35)39(48)41(25)54-5/h7-15,18-21,45,48-49H,16-17H2,1-6H3/t20-,21-/m1/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = LSUTUUOITDQYNO-NHCUHLMSSA-N

| SMILES = C[C@H](CC1=C(C(=C2C(=O)C=C(C3=C4C(=CC(=O)C5=C(C(=C(C(=C45)C1=C32)C[C@@H](C)OC(=O)OC6=CC=C(C=C6)O)OC)O)OC)OC)O)OC)OC(=O)C7=CC=CC=C7

}}

|Section2={{Chembox Properties

| C=44 | H=38 | O=14

| Appearance = red to brown powder

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

| LogP = 7.65

| pKa = 5.46

}}

|Section7={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Calphostin C is a natural chemical compound. It is one of the calphostins, isolated from the fungus Cladosporium cladosporioides.{{Cite journal | journal = J. Antibiot. | year = 1989 | volume = 42 | pages = 1470–1474 | author1 = Kobayashi, E | author2 = Ando, K | author3 = Nakano, H | author4 = Iida, T | author5 = Ohno, H | author6 = Morimoto, M | author7 = Tamaoki, T | pmid = 2478514 | title = Calphostins (UCN-1028), novel and specific inhibitors of protein kinase C. I. Fermentation, isolation, physico-chemical properties and biological activities | issue = 10 | doi=10.7164/antibiotics.42.1470| doi-access = free }}{{cite journal | journal = J. Antibiot. | year = 1989 | volume = 42 | pages = 1475–1481 | author1 = Iida, T | author2 = Kobayashi, E | author3 = Yoshida, M | author4 = Sano, H | pmid = 2478515 | title = Calphostins, novel and specific inhibitors of protein kinase C. II. Chemical structures | issue = 10 | doi=10.7164/antibiotics.42.1475| doi-access = free }} Calphostin C is a potent inhibitor of protein kinase C (PKC).