Canbisol

{{Short description|Synthetic cannabinoid derivative drug}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| class = Cannabinoid

| verifiedrevid = 451563858

| IUPAC_name = (6aR,9R,10aR)-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,8,9,10,10a-hexahydrobenzo[c]chromene-1,9-diol

| image = Canbisol Structure.svg

| image_class = skin-invert-image

| width = 250

| image2 = Canbisol 3D BS.png

| image_class2 = bg-transparent

| width2 = 250

| tradename =

| legal_status =

| routes_of_administration =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 56689-43-1

| ATC_prefix = none

| PubChem = 41969

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 2105525

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = NZ1ZPC4WSF

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 16736847

| C = 24

| H = 38

| O = 3

| smiles = Oc1cc(C(C)(C)CCCCCC)cc(c1C2C3)OC(C)(C)C2CCC3O

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C24H38O3/c1-6-7-8-9-12-23(2,3)16-13-20(26)22-18-15-17(25)10-11-19(18)24(4,5)27-21(22)14-16/h13-14,17-19,25-26H,6-12,15H2,1-5H3/t17?,18-,19-/m0/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = UEKGZFCGRQYMRM-MNNMKWMVSA-N

}}

Canbisol (Nabidrox) is a synthetic cannabinoid derivative that is the dimethylheptyl homologue of 9-nor-9β-hydroxyhexahydrocannabinol (HHC). It is a potent agonist at both the CB₁ and CB₂ receptors, with a binding affinity of 0.1 nM at CB₁ and 0.2 nM at CB₂.{{cite journal | vauthors = Rhee MH, Vogel Z, Barg J, Bayewitch M, Levy R, Hanus L, Breuer A, Mechoulam R | display-authors = 6 | title = Cannabinol derivatives: binding to cannabinoid receptors and inhibition of adenylylcyclase | journal = Journal of Medicinal Chemistry | volume = 40 | issue = 20 | pages = 3228–33 | date = September 1997 | pmid = 9379442 | doi = 10.1021/jm970126f }} It is mainly used in scientific research, in receptor binding studies to determine the structure and function of the cannabinoid receptors,{{cite journal | vauthors = Rhee MH, Nevo I, Bayewitch ML, Zagoory O, Vogel Z | title = Functional role of tryptophan residues in the fourth transmembrane domain of the CB(2) cannabinoid receptor | journal = Journal of Neurochemistry | volume = 75 | issue = 6 | pages = 2485–91 | date = December 2000 | pmid = 11080201 | doi = 10.1046/j.1471-4159.2000.0752485.x | s2cid = 18339666 | doi-access = }}{{cite journal | vauthors = Rhee MH | title = Functional role of serine residues of transmembrane dopamin VII in signal transduction of CB2 cannabinoid receptor | journal = Journal of Veterinary Science | volume = 3 | issue = 3 | pages = 185–91 | date = September 2002 | pmid = 12514330 | doi = 10.4142/jvs.2002.3.3.185| doi-access = free }}{{cite journal | vauthors = Zhang R, Hurst DP, Barnett-Norris J, Reggio PH, Song ZH | title = Cysteine 2.59(89) in the second transmembrane domain of human CB2 receptor is accessible within the ligand binding crevice: evidence for possible CB2 deviation from a rhodopsin template | journal = Molecular Pharmacology | volume = 68 | issue = 1 | pages = 69–83 | date = July 2005 | pmid = 15840841 | doi = 10.1124/mol.104.007823 | s2cid = 6488891 }} but has been made illegal in some countries due to its possible abuse potential as a cannabinomimetic drug.[http://www.opsi.gov.uk/si/si2009/draft/ukdsi_9780111486610_en_1 The Misuse of Drugs Act 1971 (Amendment) Order 2009]