Cannabinodiol

{{Short description|Chemical compound}}

{{distinguish|cannabinol|cannabidiol}}

{{Drugbox

| IUPAC_name = 5'-Methyl-4-pentyl-2'-(prop-1-en-2-yl)-[1,1'-biphenyl]-2,6-diol

| image = Cannabinodiol.svg

| image_class = skin-invert-image

| image2 = CBND 3D BS.png

| image_class2 = bg-transparent

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA = Schedule II

| legal_DE =

| legal_UK = PSA

| legal_UK_comment =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 39624-81-2

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = CNY5ZTN8E3

| ATC_prefix = None

| ATC_suffix =

| PubChem = 11551346

| ChemSpiderID = 9726124

| C=21 | H=26 | O=2

| molecular_weight =

| smiles = CCCCCC1=CC(=C(C(=C1)O)C2=C(C=CC(=C2)C)C(=C)C)O

| StdInChI = 1S/C21H26O2/c1-5-6-7-8-16-12-19(22)21(20(23)13-16)18-11-15(4)9-10-17(18)14(2)3/h9-13,22-23H,2,5-8H2,1,3-4H3

| StdInChIKey = TWKHUZXSTKISQC-UHFFFAOYSA-N

}}

Cannabinodiol (CBND), also known as cannabidinodiol,{{cite patent | url=https://www.google.com/patents/US9084771 | country = US | number = 9084771 | title = Methods and compositions for treating cancer | assign1 =Sutter West Bay Hospitals | pubdate = 21 July 2015 | inventor = McAllister SD, Desprez PY }} cannabinoid that is present in the plant Cannabis sativa at low concentrations.{{cite journal | vauthors = Ch Lousberg RJ, Bercht CL, van Ooyen R, Spronck HJ |title=Cannabinodiol: Conclusive identification and synthesis of a new cannabinoid from Cannabis sativa |journal=Phytochemistry |date=1 January 1977 |pages=595–597 |volume=16 |issue=5 |doi=10.1016/0031-9422(77)80023-X|bibcode=1977PChem..16..595R }} It is the fully aromatized derivative of cannabidiol (CBD) and can occur as a product of the photochemical conversion of cannabinol (CBN).{{cite journal | vauthors = Elsohly MA, Slade D | title = Chemical constituents of marijuana: the complex mixture of natural cannabinoids | journal = Life Sciences | volume = 78 | issue = 5 | pages = 539–548 | date = December 2005 | pmid = 16199061 | doi = 10.1016/j.lfs.2005.09.011 | series = Natureceuticals (Natural Products), Nutraceuticals, Herbal Botanicals, and Psychoactives: Drug Discovery and Drug-Drug Interactions; Volume I: Natureceuticals (Natural Products), Herbal Botanicals, Psychoactive Hallucinogens and Related Products }}

See also

References