Cannabivarin

{{chembox

| Watchedfields = changed

| verifiedrevid = 431281815

| Name = Cannabivarin

| ImageFile = Cannabivarin.svg

| ImageClass = skin-invert-image

| ImageSize = 250px

| ImageFile2 = Cannabivarin molecule ball.png

| ImageSize2 = 250px

| PIN = 6,6,9-Trimethyl-3-propyl-6H-dibenzo[b,d]pyran-1-ol

| OtherNames = 6,6,9-Trimethyl-3-propyl-6H-benzo[c]chromen-1-ol

|Section1={{Chembox Identifiers

| Abbreviations =

| InChIKey = SVTKBAIRFMXQQF-UHFFFAOYAK

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C19H22O2/c1-5-6-13-10-16(20)18-14-9-12(2)7-8-15(14)19(3,4)21-17(18)11-13/h7-11,20H,5-6H2,1-4H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = SVTKBAIRFMXQQF-UHFFFAOYSA-N

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 33745-21-0

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = MHH8UW410N

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 540898

| EINECS =

| PubChem = 622545

| SMILES = Oc2cc(cc1OC(c3c(c12)cc(cc3)C)(C)C)CCC

| InChI = 1/C19H22O2/c1-5-6-13-10-16(20)18-14-9-12(2)7-8-15(14)19(3,4)21-17(18)11-13/h7-11,20H,5-6H2,1-4H3

| RTECS =

| MeSHName = cannabivarin

| ChEBI =

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG =

}}

|Section2={{Chembox Properties

| Formula = C₁₉H₂₂O₂

| MolarMass = 282.38 g/mol

| Appearance =

| Density =

| MeltingPt =

| MeltingPt_notes =

| BoilingPt =

| BoilingPt_notes =

| Solubility =

| SolubleOther =

| Solvent =

| LogP =

| VaporPressure =

| HenryConstant =

| AtmosphericOHRateConstant =

| pKa =

| pKb = }}

|Section3={{Chembox Structure

| CrystalStruct =

| Coordination =

| MolShape = }}

|Section4={{Chembox Thermochemistry

| DeltaHf =

| DeltaHc =

| Entropy =

| HeatCapacity = }}

|Section5={{Chembox Pharmacology

| AdminRoutes =

| Bioavail =

| Metabolism =

| HalfLife =

| ProteinBound =

| Excretion =

| Legal_status =

| Legal_US =

| Legal_UK =

| Legal_AU =

| Legal_CA =

| Pregnancy_category =

| Pregnancy_AU =

| Pregnancy_US = }}

|Section6={{Chembox Explosive

| ShockSens =

| FrictionSens =

| DetonationV =

| REFactor = }}

|Section7={{Chembox Hazards

| ExternalSDS =

| MainHazards =

| NFPA-H =

| NFPA-F =

| NFPA-R =

| NFPA-S =

| FlashPt =

| AutoignitionPt =

| ExploLimits =

| LD50 =

| PEL = }}

|Section8={{Chembox Related

| OtherAnions =

| OtherCations =

| OtherFunction =

| OtherFunction_label =

| OtherCompounds = }}

}}

Cannabivarin (CBV), also known as cannabivarol, is considered a non-psychoactive cannabinoid — it does not produce the euphoric side effects found in THC. Minor amounts of CBV are found in the hemp plant Cannabis sativa. It is an analog of cannabinol (CBN) with the side chain shortened by two methylene bridges ({{chem2|\sCH2\s}}). CBV is an oxidation product of tetrahydrocannabivarin (THCV, THV).{{cite journal |author=Keith Bailey, Denise Gagné|title=Distinction of synthetic cannabidiol, cannabichromene, and cannabivarin by GLC using on-column methylation |doi=10.1002/jps.2600641033 |journal = Journal of Pharmaceutical Sciences |volume = 64 |issue = 10 |pages = 1719–1720 |date = October 1975 |pmid=1185546 |citeseerx=10.1.1.689.8592 }}