Carbuterol

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 443941802

| IUPAC_name = (RS)-{5-[2-(tert-butylamino)-1-hydroxyethyl]-2-hydroxyphenyl}urea

| image = Carbuterol.svg

| width = 230

| chirality = Racemic mixture

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU = S4

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 34866-47-2

| ATC_prefix = R03

| ATC_suffix = CC10

| ATC_supplemental =

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 2110780

| PubChem = 36976

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 33928

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 0N12JR32MR

| C = 13

| H = 21

| N = 3

| O = 3

| smiles = O=C(Nc1cc(ccc1O)C(O)CNC(C)(C)C)N

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C13H21N3O3/c1-13(2,3)15-7-11(18)8-4-5-10(17)9(6-8)16-12(14)19/h4-6,11,15,17-18H,7H2,1-3H3,(H3,14,16,19)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = KEMXXQOFIRIICG-UHFFFAOYSA-N

}}

Carbuterol (INN; carbuterol hydrochloride USAN) is a short-acting β₂ adrenoreceptor agonist.{{cite journal | vauthors = Wardell JR, Colella DF, Shetzline A, Fowler PJ | title = Studies on carbuterol (SK & F 40383-A), a new selective bronchodilator agent | journal = The Journal of Pharmacology and Experimental Therapeutics | volume = 189 | issue = 1 | pages = 167–84 | date = April 1974 | pmid = 4823290 | url = http://jpet.aspetjournals.org/content/189/1/167.short }}{{cite patent | inventor = Lunts LH, Collin DT | title = 1-phenyl-2-aminäthanol-Derivate und Verfahren zu ihrer Herstellung un ihre Verwendung | pubdate = 1970 | country = DE | number = 2032642 | assign1 = Allen & Hansburys Ltd }}