Cardamomin

{{Chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 427738547

| Name = Cardamomin

| ImageFile = Cardamomin.svg

| PIN = 2′,4′-Dihydroxy-6′-methoxychalcone

| OtherNames = (2E)-1-(2,4-Dihydroxy-6-methoxyphenyl)-3-phenyl-2-propen-1-one

|Section1={{Chembox Identifiers

| Abbreviations =

| CASNo = 19309-14-9

| CASNo_Ref = {{cascite|correct|??}}=

| EINECS =

| PubChem = 641785

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 378104

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 557026

| InChI = 1/C16H14O4/c1-20-15-10-12(17)9-14(19)16(15)13(18)8-7-11-5-3-2-4-6-11/h2-10,17,19H,1H3/b8-7+

| InChIKey = NYSZJNUIVUBQMM-BQYQJAHWBN

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C16H14O4/c1-20-15-10-12(17)9-14(19)16(15)13(18)8-7-11-5-3-2-4-6-11/h2-10,17,19H,1H3/b8-7+

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = NYSZJNUIVUBQMM-BQYQJAHWSA-N

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = H8KP1OJ8JX

| SMILES = COC1=CC(=CC(=C1C(=O)C=CC2=CC=CC=C2)O)O

| RTECS =

| MeSHName =

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI =

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG =

}}

|Section2={{Chembox Properties

| Formula = C16H14O4

| MolarMass = 270.27 g/mol

| Appearance =

| Density =

| MeltingPt =

| MeltingPt_notes =

| BoilingPt =

| BoilingPt_notes =

| Solubility =

| SolubleOther =

| Solvent =

| LogP =

| VaporPressure =

| HenryConstant =

| AtmosphericOHRateConstant =

| pKa =

| pKb =

}}

|Section3={{Chembox Structure

| CrystalStruct =

| Coordination =

| MolShape =

}}

|Section4={{Chembox Thermochemistry

| DeltaHf =

| DeltaHc =

| Entropy =

| HeatCapacity =

}}

|Section5={{Chembox Pharmacology

| AdminRoutes =

| Bioavail =

| Metabolism =

| HalfLife =

| ProteinBound =

| Excretion =

| Legal_status =

| Legal_US =

| Legal_UK =

| Legal_AU =

| Legal_CA =

| Pregnancy_category =

| Pregnancy_AU =

| Pregnancy_US =

}}

|Section6={{Chembox Explosive

| ShockSens =

| FrictionSens =

| DetonationV =

| REFactor =

}}

|Section7={{Chembox Hazards

| ExternalSDS =

| MainHazards =

| NFPA-H =

| NFPA-F =

| NFPA-R =

| NFPA-S =

| FlashPt =

| AutoignitionPt =

| ExploLimits =

| LD50 =

| PEL =

}}

|Section8={{Chembox Related

| OtherAnions =

| OtherCations =

| OtherFunction =

| OtherFunction_label =

| OtherCompounds =

}}

}}

Cardamomin (also known as cardamonin) is a chalconoid that has been isolated from several plants including Alpinia katsumadai{{Cite journal

| last1 = Kimura | first1 = Y.

| last2 = Takahashi | first2 = S.

| last3 = Yoshida | first3 = I.

| title = Studies on the constituents of Alpinia. XII. On the constituents of the seeds of Alpinia katsumadai hayata. I. The structure of cardamomin

| journal = Yakugaku Zasshi

| volume = 88

| issue = 2

| pages = 239–241

| year = 1968

| pmid = 5692492

| doi=10.1248/yakushi1947.88.2_239

| doi-access = free

}} and Alpinia conchigera.{{Cite journal | last1 = Lee | first1 = J. -H. | last2 = Jung | first2 = H. S. | last3 = Giang | first3 = P. M. | last4 = Jin | first4 = X. | last5 = Lee | first5 = S. | last6 = Son | first6 = P. T. | last7 = Lee | first7 = D. | last8 = Hong | first8 = Y. S. | last9 = Lee | first9 = K. | last10 = Lee | first10 = J. J. | title = Blockade of Nuclear Factor- B Signaling Pathway and Anti-Inflammatory Activity of Cardamomin, a Chalcone Analog from Alpinia conchigera | doi = 10.1124/jpet.105.092486 | journal = Journal of Pharmacology and Experimental Therapeutics | volume = 316 | issue = 1 | pages = 271–278 | year = 2005 | pmid = 16183703| s2cid = 6069217 }} It has received growing attention from the scientific community due to the expectations toward its benefits to human health.{{cite journal | doi = 10.1089/jmf.2013.0061 | title=An Overview on Cardamonin | journal=Journal of Medicinal Food | date=2014 | volume=17 | issue=6 | pages=633–640 | first=Luís Moreira | last=Gonçalves| pmc=4060836 | pmid=24433078}}

References

{{reflist}}

{{Chalconoid}}

Category:Chalconoids

{{aromatic-stub}}