Carpindolol

{{Short description|Chemical compound}}

{{Infobox drug

| drug_name =

| IUPAC_name = Isopropyl 4-{2-hydroxy-3-[(2-methyl-2-propanyl)amino]propoxy}-1H-indole-2-carboxylate

| image = Carpindolol.svg

| alt =

| caption =

| tradename =

| Drugs.com =

| MedlinePlus =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category=

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 39731-05-0

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = W8F97XP38W

| ATCvet =

| ATC_prefix = none

| ATC_suffix =

| PubChem = 193949

| ChEMBL = 1742440

| ChemSpiderID = 168304

| DrugBank =

| C=19 | H=28 | N=2 | O=4

| smiles = CC(C)OC(=O)C1=CC2=C(N1)C=CC=C2OCC(CNC(C)(C)C)O

| StdInChI = 1S/C19H28N2O4/c1-12(2)25-18(23)16-9-14-15(21-16)7-6-8-17(14)24-11-13(22)10-20-19(3,4)5/h6-9,12-13,20-22H,10-11H2,1-5H3

| StdInChIKey = SJYFDORQYYEJLB-UHFFFAOYSA-N

}}

Carpindolol is a beta blocker.{{cite book | title = Concise Dictionary of Pharmacological Agents: Properties and Synonyms | vauthors = Morton IK, Hall JM | publisher = Springer | year = 1999 | page = 68}} It also has activity at serotonin receptors, and is unusual in that it acts as an antagonist at the 5-HT_1B receptor, but is an agonist at the closely related 5-HT_1D receptor.Schoeffter P, Hoyer D. 5-Hydroxytryptamine 5-HT1B and 5-HT1D receptors mediating inhibition of adenylate cyclase activity. Pharmacological comparison with special reference to the effects of yohimbine, rauwolscine and some beta-adrenoceptor antagonists. Naunyn Schmiedebergs Arch Pharmacol. 1989 Sep;340(3):285-92. {{doi|10.1007/BF00168512}} {{pmid|2572975}}