Cedrene

{{Chembox

| Name = (−)-α-cedrene

| ImageFile = alpha-cedrene skeletal.svg

| ImageSize =

| ImageAlt =

| IUPACName = Cedr-8-ene

| SystematicName = (3R,3aS,7S,8aS)-3,6,8,8-Tetramethyl-2,3,4,7,8,8a-hexahydro-1H-3a,7-methanoazulene

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 11028-42-5

| CASNo1_Ref = {{cascite|correct|CAS}}

| CASNo1 = 469-61-4

| CASNo1_Comment = (α)

| CASNo2_Ref = {{cascite|correct|CAS}}

| CASNo2 = 546-28-1

| CASNo2_Comment = (β)

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 1M4BF4O9SA

| UNII1_Ref = {{fdacite|correct|FDA}}

| UNII1 = 50D4A81G8T

| UNII1_Comment = (α)

| UNII2_Ref = {{fdacite|correct|FDA}}

| UNII2 = 6QL7ERD5Q1

| UNII2_Comment = (β)

| PubChem = 6431015

| ChemSpiderID = 4936353

| ChEBI = 10216

| KEGG = C09630

| EC_number = 234-257-7

| Beilstein = 2207578

| SMILES = C[C@@H]1CC[C@@H]2[C@]13CC=C([C@H](C3)C2(C)C)C

| InChI = 1/C15H24/c1-10-7-8-15-9-12(10)14(3,4)13(15)6-5-11(15)2/h7,11-13H,5-6,8-9H2,1-4H3/t11-,12+,13+,15+/m1/s1

| InChIKey = IRAQOCYXUMOFCW-OSFYFWSMBF

| StdInChI = 1S/C15H24/c1-10-7-8-15-9-12(10)14(3,4)13(15)6-5-11(15)2/h7,11-13H,5-6,8-9H2,1-4H3/t11-,12+,13+,15+/m1/s1

| StdInChIKey = IRAQOCYXUMOFCW-OSFYFWSMSA-N

}}

|Section2={{Chembox Properties

| C=15 | H=24

| Appearance =

| Density = 0.932 g/mL at 20 °C{{Aldrich|id=22133|name=(−)-α-Cedrene|accessdate=8 July 2012}}

| MeltingPt =

| BoilingPt = 261–262 °C

| Solubility = }}

|Section3={{Chembox Hazards

| GHSPictograms = {{GHS02}}{{GHS08}}{{GHS09}}

| GHSSignalWord = Danger

| HPhrases = {{H-phrases|226|304|410}}

| PPhrases = {{P-phrases|210|233|240|241|242|243|273|280|301+310|303+361+353|331|370+378|391|403+235|405|501}}

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

{{Chembox

| Name = (+)-β-cedrene

| ImageFile = beta-cedrene skeletal.svg

| ImageSize =

| ImageAlt =

| IUPACName = Cedr-8(15)-ene

| SystematicName = (3R,3aS,7S,8aS)-3,6,8,8-Tetramethyl-6-methylideneoctahydro-1H-3a,7-methanoazulene

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 546-28-1

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 6QL7ERD5Q1

| PubChem = 11106485

| ChemSpiderID = 9281621

| SMILES = C[C@@H]1CC[C@@H]2[C@]13CCC(=C)[C@H](C3)C2(C)C

| InChI = 1/C15H24/c1-10-7-8-15-9-12(10)14(3,4)13(15)6-5-11(15)2/h11-13H,1,5-9H2,2-4H3/t11-,12+,13+,15+/m1/s1

| InChIKey = DYLPEFGBWGEFBB-OSFYFWSMBA

| StdInChI = 1S/C15H24/c1-10-7-8-15-9-12(10)14(3,4)13(15)6-5-11(15)2/h11-13H,1,5-9H2,2-4H3/t11-,12+,13+,15+/m1/s1

| StdInChIKey = DYLPEFGBWGEFBB-OSFYFWSMSA-N

}}

|Section2={{Chembox Properties

| C=15 | H=24

| Appearance =

| Density = 0.932 g/mL at 20 °C{{Aldrich|id=22134|name=(+)-β-Cedrene|accessdate=8 July 2012}}

| MeltingPt =

| BoilingPt = 263–264 °C

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Cedrene is a sesquiterpene found in the essential oil of cedar. The two isomers present in the oil are (−)-α-cedrene{{Cite journal | last1 = Lee | first1 = H. Y. | last2 = Lee | first2 = S. | last3 = Kim | first3 = D. | last4 = Kim | first4 = B. K. | last5 = Bahn | first5 = J. S. | last6 = Kim | first6 = S. | doi = 10.1016/S0040-4039(98)01680-3 | title = Total synthesis of α-cedrene: A new strategy utilizing N-aziridinylimine radical chemistry | journal = Tetrahedron Letters | volume = 39 | issue = 42 | pages = 7713–7716 | year = 1998 }}{{Cite journal

| last1 = Takigawa | first1 = H.

| last2 = Kubota | first2 = H.

| last3 = Sonohara | first3 = H.

| last4 = Okuda | first4 = M.

| last5 = Tanaka | first5 = S.

| last6 = Fujikura | first6 = Y.

| last7 = Ito | first7 = S.

| title = Novel allylic oxidation of α-cedrene to sec-cedrenol by a Rhodococcus strain

| journal = Applied and Environmental Microbiology

| volume = 59

| issue = 5

| pages = 1336–1341

| year = 1993

| doi = 10.1128/aem.59.5.1336-1341.1993

| pmid = 16348930

| pmc = 182086

| bibcode = 1993ApEnM..59.1336T

}} and (+)-β-cedrene,{{Cite journal

| last1 = Kerr | first1 = W. J.

| last2 = McLaughlin | first2 = M.

| last3 = Morrison | first3 = A. J.

| last4 = Pauson | first4 = P. L.

| title = Formal total synthesis of (±)-α- and β-cedrene by preparation of cedrone. Construction of the tricyclic carbon skeleton by the use of a highly efficient intramolecular Khand annulation

| journal = Organic Letters

| volume = 3

| issue = 19

| pages = 2945–2948

| year = 2001

| pmid = 11554814 | doi=10.1021/ol016054a

}} which differ in the position of a double bond.