Cefaloglycin
{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields = changed
| verifiedrevid = 460022500
| IUPAC_name = (6R,7R)-3-[(acetyloxy)methyl]-7-{[(2R)-2-amino-2-phenylacetyl]amino}-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid
| image = Cefaloglycin.svg
| tradename =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 3577-01-3
| ATC_prefix = none
| ATC_suffix =
| ATC_supplemental =
| PubChem = 19150
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00689
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 18069
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = HD2D469W6U
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D01949
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 34613
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 1200971
| C=18 | H=19 | N=3 | O=6 | S=1
| smiles = O=C2N1/C(=C(\CS[C@@H]1[C@@H]2NC(=O)[C@@H](c3ccccc3)N)COC(=O)C)C(=O)O
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C18H19N3O6S/c1-9(22)27-7-11-8-28-17-13(16(24)21(17)14(11)18(25)26)20-15(23)12(19)10-5-3-2-4-6-10/h2-6,12-13,17H,7-8,19H2,1H3,(H,20,23)(H,25,26)/t12-,13-,17-/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = FUBBGQLTSCSAON-PBFPGSCMSA-N
}}
Cefaloglycin INN (also spelled cephaloglycin) is a first-generation cephalosporin antibiotic.
References
- {{cite journal |vauthors=Tune B, Hsu C | title = The renal mitochondrial toxicity of beta-lactam antibiotics: in vitro effects of cephaloglycin and imipenem. | journal = J Am Soc Nephrol | volume = 1 | issue = 5 | pages = 815–21 | year = 1990 | doi = 10.1681/ASN.V15815 | pmid = 2133431| doi-access = free }}
- {{cite journal |vauthors=Tune B, Fravert D, Hsu C | title = Oxidative and mitochondrial toxic effects of cephalosporin antibiotics in the kidney. A comparative study of cephaloridine and cephaloglycin. | journal = Biochem Pharmacol | volume = 38 | issue = 5 | pages = 795–802 | year = 1989 | pmid = 2930580 | doi = 10.1016/0006-2952(89)90233-5| doi-access = free }}
External links
- {{Commonscatinline|Cefaloglycin}}
{{CephalosporinAntiBiotics}}
Category:Cephalosporin antibiotics
{{antibiotic-stub}}
{{stereochemistry-stub}}