Cefaloglycin

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 460022500

| IUPAC_name = (6R,7R)-3-[(acetyloxy)methyl]-7-{[(2R)-2-amino-2-phenylacetyl]amino}-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid

| image = Cefaloglycin.svg

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 3577-01-3

| ATC_prefix = none

| ATC_suffix =

| ATC_supplemental =

| PubChem = 19150

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB00689

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 18069

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = HD2D469W6U

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D01949

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 34613

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1200971

| C=18 | H=19 | N=3 | O=6 | S=1

| smiles = O=C2N1/C(=C(\CS[C@@H]1[C@@H]2NC(=O)[C@@H](c3ccccc3)N)COC(=O)C)C(=O)O

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C18H19N3O6S/c1-9(22)27-7-11-8-28-17-13(16(24)21(17)14(11)18(25)26)20-15(23)12(19)10-5-3-2-4-6-10/h2-6,12-13,17H,7-8,19H2,1H3,(H,20,23)(H,25,26)/t12-,13-,17-/m1/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = FUBBGQLTSCSAON-PBFPGSCMSA-N

}}

Cefaloglycin INN (also spelled cephaloglycin) is a first-generation cephalosporin antibiotic.

References

  • {{cite journal |vauthors=Tune B, Hsu C | title = The renal mitochondrial toxicity of beta-lactam antibiotics: in vitro effects of cephaloglycin and imipenem. | journal = J Am Soc Nephrol | volume = 1 | issue = 5 | pages = 815–21 | year = 1990 | doi = 10.1681/ASN.V15815 | pmid = 2133431| doi-access = free }}
  • {{cite journal |vauthors=Tune B, Fravert D, Hsu C | title = Oxidative and mitochondrial toxic effects of cephalosporin antibiotics in the kidney. A comparative study of cephaloridine and cephaloglycin. | journal = Biochem Pharmacol | volume = 38 | issue = 5 | pages = 795–802 | year = 1989 | pmid = 2930580 | doi = 10.1016/0006-2952(89)90233-5| doi-access = free }}