Cefbuperazone

{{cs1 config|name-list-style=vanc}}

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 444604058

| IUPAC_name = (6R,7S)-7-([(2R,3S)-2-[(4-Ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-3-hydroxybutanoyl]amino)-7-methoxy-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid

| image = Cefbuperazone.svg

| tradename =

| Drugs.com = {{drugs.com|international|cefbuperazone}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status = Rx-only

| routes_of_administration = IM, IV

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 76610-84-9

| ATC_prefix = J01

| ATC_suffix = DC13

| ATC_supplemental =

| PubChem = 127527

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1908372

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = T0785J3X40

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D03423

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 113142

| smiles = CCN1CCN(C(=O)C1=O)C(=O)N[C@H]([C@H](C)O)C(=O)N[C@]2([C@@H]3N(C2=O)C(=C(CS3)CSC4=NN=NN4C)C(=O)O)OC

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C22H29N9O9S2/c1-5-29-6-7-30(16(35)15(29)34)20(39)23-12(10(2)32)14(33)24-22(40-4)18(38)31-13(17(36)37)11(8-41-19(22)31)9-42-21-25-26-27-28(21)3/h10,12,19,32H,5-9H2,1-4H3,(H,23,39)(H,24,33)(H,36,37)/t10-,12+,19+,22-/m0/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = SMSRCGPDNDCXFR-CYWZMYCQSA-N

| chemical_formula =

| C=22 | H=29 | N=9 | O=9 | S=2

}}

Cefbuperazone (INN) is a second-generation cephalosporin antibiotic.{{cite journal | vauthors = Izumi K, Kawazoe K, Mikamo H, Ito K, Tamaya T | title = In vivo bacterial regrowth-inhibition effect of cefbuperazone and amikacin in puerperal uterine cavity | journal = Journal of Chemotherapy | volume = 7 | pages = 173–6 | date = November 1995 | issue = Suppl 4 | pmid = 8904147 }}{{cite patent | country = US | number = 4754030 | title = Cefbuperazone crystalline triethylamine salt }}