Cefozopran
{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 443787193
| IUPAC_name = (6R,7R)-7-
| image = Cefozopran.svg
| width = 280
| tradename =
| Drugs.com = {{drugs.com|international|cefozopran}}
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 113359-04-9
| ATC_prefix = J01
| ATC_suffix = DE03
| ATC_supplemental =
| PubChem = 9571080
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 1276663
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 1LG87K28LW
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D01052
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 7845546
| smiles = O=C2N1/C(=C(\CS[C@@H]1[C@@H]2NC(=O)C(=N\OC)/c3nc(sn3)N)Cn5c4cccn[n+]4cc5)C([O-])=O
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C19H17N9O5S2/c1-33-24-11(14-23-19(20)35-25-14)15(29)22-12-16(30)28-13(18(31)32)9(8-34-17(12)28)7-26-5-6-27-10(26)3-2-4-21-27/h2-6,12,17H,7-8H2,1H3,(H3-,20,22,23,25,29,31,32)/b24-11-/t12-,17-/m1/s1
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = QDUIJCOKQCCXQY-WHJQOFBOSA-N
| chemical_formula =
| C=19 | H=17 | N=9 | O=5 | S=2
}}
Cefozopran (INN) is a fourth-generation cephalosporin.{{cite book | vauthors = Chang XM | chapter = Chapter 34: Market to Market | veditors = Bristol JA | date = December 1996 | title = Annual Reports in Medicinal Chemistry | volume = 31 | page = 339 | chapter-url = https://books.google.com/books?id=zlYa3l7Rg7AC&q=Cefozopran&pg=PA339 |publisher=Academic Press |location=San Diego, Calif. | isbn = 978-0-08-058375-4 }}
Spectrum of bacterial susceptibility and resistance
Most of the strains of Stenotrophomonas maltophilia have developed resistance toward cefozopran.{{cite web|title=Cefozopran Susceptibility and Resistance Data|url=http://www.toku-e.com/Assets/MIC/Cefozopran%20hydrochloride.pdf|access-date=23 July 2013}}
References
{{reflist}}
{{CephalosporinAntiBiotics|state=collapsed}}
Category:Cephalosporin antibiotics
{{antibiotic-stub}}