Cefozopran

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 443787193

| IUPAC_name = (6R,7R)-7-[[(2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)- 2-methoxyiminoacetyl]amino]-3-(imidazo[2,3-f]pyridazin- 4-ium-1-ylmethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0] oct-2-ene-2-carboxylate

| image = Cefozopran.svg

| width = 280

| tradename =

| Drugs.com = {{drugs.com|international|cefozopran}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 113359-04-9

| ATC_prefix = J01

| ATC_suffix = DE03

| ATC_supplemental =

| PubChem = 9571080

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1276663

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 1LG87K28LW

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D01052

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 7845546

| smiles = O=C2N1/C(=C(\CS[C@@H]1[C@@H]2NC(=O)C(=N\OC)/c3nc(sn3)N)Cn5c4cccn[n+]4cc5)C([O-])=O

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C19H17N9O5S2/c1-33-24-11(14-23-19(20)35-25-14)15(29)22-12-16(30)28-13(18(31)32)9(8-34-17(12)28)7-26-5-6-27-10(26)3-2-4-21-27/h2-6,12,17H,7-8H2,1H3,(H3-,20,22,23,25,29,31,32)/b24-11-/t12-,17-/m1/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = QDUIJCOKQCCXQY-WHJQOFBOSA-N

| chemical_formula =

| C=19 | H=17 | N=9 | O=5 | S=2

}}

Cefozopran (INN) is a fourth-generation cephalosporin.{{cite book | vauthors = Chang XM | chapter = Chapter 34: Market to Market | veditors = Bristol JA | date = December 1996 | title = Annual Reports in Medicinal Chemistry | volume = 31 | page = 339 | chapter-url = https://books.google.com/books?id=zlYa3l7Rg7AC&q=Cefozopran&pg=PA339 |publisher=Academic Press |location=San Diego, Calif. | isbn = 978-0-08-058375-4 }}

Spectrum of bacterial susceptibility and resistance

Most of the strains of Stenotrophomonas maltophilia have developed resistance toward cefozopran.{{cite web|title=Cefozopran Susceptibility and Resistance Data|url=http://www.toku-e.com/Assets/MIC/Cefozopran%20hydrochloride.pdf|access-date=23 July 2013}}

References