Cefpiramide
{{No footnotes|date=November 2024}}
{{cs1 config|name-list-style=vanc}}
{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields = changed
| verifiedrevid = 460024380
| IUPAC_name = (6R)-7-{[(2R)-2-(4-hydroxyphenyl)-2-[(6-methyl-
4-oxo-1H-pyridine-3-carbonyl)amino]acetyl]amino}-
3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-
5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid
| image = Cefpiramide.svg
| tradename =
| Drugs.com = {{drugs.com|international|cefpiramide}}
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration = Intravenous, intramuscular
| bioavailability =
| protein_bound = 93% to 99.3%
| metabolism =
| elimination_half-life = 4.44 hours
| excretion = Renal and fecal
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 70797-11-4
| ATC_prefix = J01
| ATC_suffix = DD11
| ATC_supplemental =
| PubChem = 636405
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00430
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 552192
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = P936YA152N
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D03428
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 59213
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 1201204
| C=25 | H=24 | N=8 | O=7 | S=2
| smiles = O=C2N1/C(=C(\CS[C@@H]1[C@@H]2NC(=O)[C@@H](c3ccc(O)cc3)NC(=O)C\4=C\N\C(=C/C/4=O)C)CSc5nnnn5C)C(=O)O
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C25H24N8O7S2/c1-11-7-16(35)15(8-26-11)20(36)27-17(12-3-5-14(34)6-4-12)21(37)28-18-22(38)33-19(24(39)40)13(9-41-23(18)33)10-42-25-29-30-31-32(25)2/h3-8,17-18,23,34H,9-10H2,1-2H3,(H,26,35)(H,27,36)(H,28,37)(H,39,40)/t17-,18-,23-/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = PWAUCHMQEXVFJR-PMAPCBKXSA-N
| melting_point = 213
| melting_high = 215
| melting_notes = (dec.)
}}
Cefpiramide is a third-generation cephalosporin antibiotic.{{cn|date=January 2023}}
References
{{Reflist}}
External links
- {{cite journal | vauthors = Wang H, Yu Y, Xie X, Wang C, Zhang Y, Yuan Y, Zhang X, Liu J, Wang P, Chen M | title = In-vitro antibacterial activities of cefpiramide and other broad-spectrum antibiotics against 440 clinical isolates in China | journal = J Infect Chemother | volume = 6 | issue = 2 | pages = 81–85 | year = 2000 | pmid = 11810540 | doi = 10.1007/PL00012156| s2cid = 30532462 }}
- {{cite journal | vauthors = Iakovlev V, Vishnevskiĭ V, Khlebnikov E, Khadin I, Plavlova M, Elagina L, Izotova G | title = [Cefpiramide (Tamicin) in the treatment of purulent complications of abdominal surgery] | journal = Antibiot Khimioter | volume = 40 | issue = 9 | pages = 30–4 | year = 1995 | pmid = 8651827}}
- {{cite journal | vauthors = Sampi K, Hattori M | title = [Comparative study of cefpiramide + amikacin versus piperacillin + amikacin in granulocytopenic patients: a randomized, prospective study] | journal = Gan to Kagaku Ryoho | volume = 19 | issue = 9 | pages = 1315–20 | year = 1992 | pmid = 1503486}}
{{CephalosporinAntiBiotics}}
Category:Cephalosporin antibiotics
{{antibiotic-stub}}