Cefpirome

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 447915116

| IUPAC_name = 1-{[(6R,7R)-7-[(2E)-2-(2-amino-1,3-thiazol-4-yl)-2-(methoxyimino)acetamido]-2-carboxylato-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl}-5H,6H,7H-cyclopenta[b]pyridin-1-ium

| image = Cefpirome.svg

| tradename =

| Drugs.com = {{drugs.com|international|cefpirome}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 84957-29-9

| ATC_prefix = J01

| ATC_suffix = DE02

| PubChem = 6917674

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 2106076

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = S72Q2F09HY

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D07649

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 23089536

| smiles = CON=C(c1csc(n1)N)C(=O)NC2C3N(C2=O)C(=C(CS3)C[n+]4cccc5c4CCC5)C(=O)[O-]

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C22H22N6O5S2/c1-33-26-15(13-10-35-22(23)24-13)18(29)25-16-19(30)28-17(21(31)32)12(9-34-20(16)28)8-27-7-3-5-11-4-2-6-14(11)27/h3,5,7,10,16,20H,2,4,6,8-9H2,1H3,(H3-,23,24,25,29,31,32)/b26-15-/t16-,20+/m1/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = DKOQGJHPHLTOJR-XECLGWKCSA-N

| C=22 | H=22 | N=6 | O=5 | S=2

}}

Cefpirome is a fourth-generation cephalosporin. Trade names include Cefrom, Keiten, Broact, and Cefir. Cefpirome is considered highly active against Gram-negative bacteria, including Pseudomonas aeruginosa, and Gram-positive bacteria.{{cn|date=January 2023}}

Spectrum of bacterial susceptibility and resistance

Bacteroides fragilis, enterococci, Pseudomonas spp. and staphylococci are resistant to cefpirome sulfate, and some Haemophilus spp. and pneumococci have developed resistance to it to varying degrees.{{cite web|title=Cefpirome Sulfate spectrum of bacterial susceptibility and Resistance|url=http://www.toku-e.com/Assets/MIC/Cefpirome.pdf|access-date=10 April 2012|archive-url=https://web.archive.org/web/20160303214125/http://www.toku-e.com/Assets/MIC/Cefpirome.pdf|archive-date=3 March 2016|url-status=dead}}

References

{{CephalosporinAntiBiotics}}

Category:Cephalosporin antibiotics

Category:Thiazoles

Category:Ketoxime ethers

{{antibiotic-stub}}