Cefteram

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = (6R,7R)-7-([(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino)-3-[(5-methyltetrazol-2-yl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid

| image = Cefteram.svg

| tradename =

| Drugs.com = {{drugs.com|international|cefteram}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status = Rx-only

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 82547-58-8

| ATC_prefix = J01

| ATC_suffix = DD18

| ATC_supplemental =

| PubChem = 6537431

| DrugBank =

| ChEMBL = 2105953

| ChemSpiderID = 4576594

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 74CQ4Q3N63

| KEGG = D07655

| chemical_formula =

| C=16 | H=17 | N=9 | O=5 | S=2

| smiles = O=C2N1/C(=C(\CS[C@@H]1[C@@H]2NC(=O)C(=N\OC)\c3nc(sc3)N)Cn4nc(nn4)C)C(=O)O

}}

Cefteram (INN) is a third-generation cephalosporin antibiotic.{{cite journal | vauthors = Yamaguchi K, Ohno A, Takahashi S, Hayashi M, Yamanaka K, Hirakata Y, Mitsuyama J | title = [In vitro antibacterial activities of cefteram and other beta-lactam agents against recent clinical isolates] | journal = The Japanese Journal of Antibiotics | volume = 51 | issue = 1 | pages = 11–25 | date = January 1998 | pmid = 9557273 }}